P-Cresol
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.02063 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3 | |
Note 1 | 12,13?14,15 |
Sample description:
Compound | Type | Concentration |
---|---|---|
p-Cresol | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
9 | 10 | 11 | 14 | 15 | 12 | 13 | |
---|---|---|---|---|---|---|---|
9 | 2.247 | -14.9 | -14.9 | 1.0 | 0 | 0 | 1.0 |
10 | 0 | 2.247 | -14.9 | 1.0 | 0 | 0 | 1.0 |
11 | 0 | 0 | 2.247 | 1.0 | 0 | 0 | 1.0 |
14 | 0 | 0 | 0 | 7.132 | 8.335 | 0 | 2.301 |
15 | 0 | 0 | 0 | 0 | 6.818 | 2.301 | 0 |
12 | 0 | 0 | 0 | 0 | 0 | 6.818 | 8.335 |
13 | 0 | 0 | 0 | 0 | 0 | 0 | 7.132 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.24737 | 1.00001 | standard |
6.80977 | 0.332422 | standard |
6.82616 | 0.366767 | standard |
7.12411 | 0.301553 | standard |
7.13986 | 0.274714 | standard |
2.24698 | 1.0 | standard |
6.68198 | 0.1624 | standard |
6.89327 | 0.550462 | standard |
7.05546 | 0.461753 | standard |
7.26435 | 0.143858 | standard |
2.2472 | 1.0 | standard |
6.73432 | 0.213635 | standard |
6.87328 | 0.481307 | standard |
7.07778 | 0.398567 | standard |
7.21254 | 0.182895 | standard |
2.24725 | 1.0 | standard |
6.7582 | 0.244048 | standard |
6.86172 | 0.448096 | standard |
7.08957 | 0.370106 | standard |
7.18937 | 0.206649 | standard |
2.24728 | 1.0 | standard |
6.76573 | 0.254594 | standard |
6.85759 | 0.436479 | standard |
7.09369 | 0.359872 | standard |
7.18212 | 0.21489 | standard |
2.24728 | 1.0 | standard |
6.77163 | 0.263126 | standard |
6.85415 | 0.427703 | standard |
7.09711 | 0.352416 | standard |
7.17645 | 0.222165 | standard |
2.24732 | 1.00001 | standard |
6.79635 | 0.306319 | standard |
6.83741 | 0.389189 | standard |
7.11337 | 0.32184 | standard |
7.1527 | 0.255229 | standard |
2.24734 | 1.00001 | standard |
6.80392 | 0.318912 | standard |
6.83127 | 0.376814 | standard |
7.11929 | 0.310868 | standard |
7.14549 | 0.265918 | standard |
2.24735 | 1.0 | standard |
6.80763 | 0.329186 | standard |
6.82811 | 0.37054 | standard |
7.1223 | 0.307003 | standard |
7.14192 | 0.272885 | standard |
2.24737 | 1.00001 | standard |
6.80977 | 0.333152 | standard |
6.82615 | 0.366927 | standard |
7.12419 | 0.301623 | standard |
7.13983 | 0.274436 | standard |
2.24736 | 1.00001 | standard |
6.81124 | 0.335373 | standard |
6.82489 | 0.357196 | standard |
7.12539 | 0.295398 | standard |
7.13844 | 0.278457 | standard |
2.24737 | 1.00001 | standard |
6.81221 | 0.341336 | standard |
6.82393 | 0.357261 | standard |
7.12636 | 0.292925 | standard |
7.13749 | 0.282288 | standard |
2.24737 | 1.00001 | standard |
6.8127 | 0.341779 | standard |
6.82362 | 0.355528 | standard |
7.12669 | 0.292364 | standard |
7.13718 | 0.284685 | standard |
2.24737 | 1.00002 | standard |
6.81299 | 0.342738 | standard |
6.82323 | 0.352474 | standard |
7.127 | 0.290329 | standard |
7.13675 | 0.283595 | standard |
2.24737 | 1.00003 | standard |
6.81358 | 0.348336 | standard |
6.82275 | 0.353382 | standard |
7.12755 | 0.294188 | standard |
7.13623 | 0.290011 | standard |
2.24737 | 1.00002 | standard |
6.81387 | 0.346581 | standard |
6.82245 | 0.349749 | standard |
7.12774 | 0.287551 | standard |
7.13602 | 0.288449 | standard |
2.24737 | 1.00004 | standard |
6.81407 | 0.351757 | standard |
6.82225 | 0.354699 | standard |
7.12796 | 0.294034 | standard |
7.13581 | 0.291842 | standard |
2.24737 | 1.00004 | standard |
6.81445 | 0.350356 | standard |
6.82186 | 0.35462 | standard |
7.12827 | 0.292498 | standard |
7.13538 | 0.29284 | standard |
2.24736 | 1.00003 | standard |
6.81504 | 0.345099 | standard |
6.82138 | 0.343358 | standard |
7.1288 | 0.283933 | standard |
7.13485 | 0.282939 | standard |