Guided Ideographic Spin System Model Optimization

Global links:

GISSMO Home

GISSMO Library

GISSMO Tutorial

GISSMO-GUI

Web Services:

Peak Search

Mixture Simulation

Mol to jpg conversion

Simulation: simulation_1

BMRB entry

ALATIS cross link

Gateway cross link

Download simulation data

View entry XML

Download entry NMR-STAR

Download entry NMReDATA

External links:

NMRFAM Servers

pKa (R. Williams)

1H NMR (Hans J. Reich)

2-[2-[2-[2-(Bis(carboxymethyl)amino)ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid

Simulation outputs:

InChI=1S/C14H24N2O10/c17-11(18)7-15(8-12(19)20)1-3-25-5-6-26-4-2-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) Parameter Value
Field strength 499.84(MHz)
RMSD of the fit 0.01857
Temperature 298 K
pH 7.4
InChI InChI=1S/C14H24N2O10/c17-11(18)7-15(8-12(19)20)1-3-25-5-6-26-4-2-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)
Note 1 Oscar Li

Sample description:

Compound Type Concentration
2-[2-[2-[2-(Bis(carboxymethyl)amino)ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid solute 100mM
D2O solvent 100.0%
DSS reference 0.01mg/mL
sodium phosphate buffer 50mM
sodium azide cytocide 500uM
Show/Hide Spin System Matrix

Spin System Matrix

27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46
27 3.499 -12.4 0 0 4.803 4.803 0 0 0 0 0 0 0 0 0 0 0 0 0 0
28 0 3.499 0 0 4.803 4.803 0 0 0 0 0 0 0 0 0 0 0 0 0 0
29 0 0 3.499 -12.4 0 0 4.803 4.803 0 0 0 0 0 0 0 0 0 0 0 0
30 0 0 0 3.499 0 0 4.803 4.803 0 0 0 0 0 0 0 0 0 0 0 0
31 0 0 0 0 3.888 -12.4 0 0 0 0 0 0 0 0 0 0 0 0 0 0
32 0 0 0 0 0 3.888 0 0 0 0 0 0 0 0 0 0 0 0 0 0
33 0 0 0 0 0 0 3.888 -12.4 0 0 0 0 0 0 0 0 0 0 0 0
34 0 0 0 0 0 0 0 3.888 0 0 0 0 0 0 0 0 0 0 0 0
35 0 0 0 0 0 0 0 0 3.701 -12.4 0 0 0 0 0 0 0 0 0 0
36 0 0 0 0 0 0 0 0 0 3.701 0 0 0 0 0 0 0 0 0 0
37 0 0 0 0 0 0 0 0 0 0 3.701 -12.4 0 0 0 0 0 0 0 0
38 0 0 0 0 0 0 0 0 0 0 0 3.701 0 0 0 0 0 0 0 0
39 0 0 0 0 0 0 0 0 0 0 0 0 3.85 -12.4 0 0 0 0 0 0
40 0 0 0 0 0 0 0 0 0 0 0 0 0 3.85 0 0 0 0 0 0
41 0 0 0 0 0 0 0 0 0 0 0 0 0 0 3.85 -12.4 0 0 0 0
42 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 3.85 0 0 0 0
43 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 3.85 -12.4 0 0
44 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 3.85 0 0
45 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 3.85 -12.4
46 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 3.85

Spectra

Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale

Help

To zoom into a region, draw a box around it.
Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM Amplitude Peak Type
0.145001 standard
0.266703 standard
0.148942 standard
0.497712 standard
1.0 standard
0.158222 standard
0.27199 standard
0.148658 standard
0.207431 standard
0.25549 standard
0.524912 standard
1.0 standard
0.0920971 standard
0.214085 standard
0.192923 standard
0.477418 standard
1.0 standard
0.099654 standard
0.221287 standard
0.170571 standard
0.458619 standard
1.0 standard
0.125106 standard
0.101376 standard
0.221385 standard
0.162725 standard
0.448965 standard
1.0 standard
0.124574 standard
0.102722 standard
0.221044 standard
0.156645 standard
0.440684 standard
1.0 standard
0.317679 standard
0.123719 standard
0.128847 standard
0.256017 standard
0.157053 standard
0.484268 standard
1.00001 standard
0.286369 standard
0.140636 standard
0.13812 standard
0.264136 standard
0.154829 standard
0.49466 standard
1.0 standard
0.19595 standard
0.278615 standard
0.145491 standard
0.141692 standard
0.265506 standard
0.151855 standard
0.496126 standard
1.0 standard
0.168839 standard
0.274064 standard
0.146412 standard
0.144579 standard
0.265741 standard
0.1484 standard
0.496495 standard
1.0 standard
0.1581 standard
0.270814 standard
0.148167 standard
0.145928 standard
0.267504 standard
0.148387 standard
0.497437 standard
1.0 standard
0.154337 standard
0.270576 standard
0.14803 standard
0.147238 standard
0.267045 standard
0.147749 standard
0.497121 standard
1.0 standard
0.151689 standard
0.269543 standard
0.148593 standard
0.147326 standard
0.267913 standard
0.147417 standard
0.497574 standard
1.0 standard
0.15137 standard
0.270149 standard
0.148566 standard
0.147261 standard
0.267135 standard
0.147074 standard
0.497053 standard
1.0 standard
0.150713 standard
0.269257 standard
0.148325 standard
0.147413 standard
0.267715 standard
0.147499 standard
0.497585 standard
1.0 standard
0.149575 standard
0.268907 standard
0.148395 standard
0.147575 standard
0.267899 standard
0.147356 standard
0.497319 standard
1.0 standard
0.149232 standard
0.268602 standard
0.148509 standard
0.14738 standard
0.26803 standard
0.147485 standard
0.498152 standard
1.0 standard
0.149118 standard
0.269023 standard
0.148698 standard
0.1473 standard
0.26754 standard
0.147371 standard
0.497562 standard
1.0 standard
0.148801 standard
0.268325 standard
0.14819 standard
0.147712 standard
0.267657 standard
0.147626 standard
0.497663 standard
1.0 standard
0.148229 standard
0.267825 standard
0.14805 standard
View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks