Ellagic acid
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.00883 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H | |
Note 1 | Oscar Li |
Sample description:
Compound | Type | Concentration |
---|---|---|
Ellagic acid | solute | 100mM |
DMSO | solvent | 100.0% |
TMS | reference | 0.05% |
Spin System Matrix
23 | 24 | |
---|---|---|
23 | 7.463 | 0 |
24 | 0 | 7.463 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
7.46337 | 1.0 | standard |
-0.948973 | 5.125e-06 | standard |
7.46337 | 1.0 | standard |
-0.721935 | 2.125e-06 | standard |
7.46337 | 1.0 | standard |
-0.363377 | 1.125e-06 | standard |
7.46337 | 1.0 | standard |
-0.516124 | 1.125e-06 | standard |
7.46337 | 1.0 | standard |
-0.664705 | 1.125e-06 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |
7.46337 | 1.0 | standard |