Guided Ideographic Spin System Model Optimization

Global links:

GISSMO Home

GISSMO Library

GISSMO Tutorial

GISSMO-GUI

Web Services:

Peak Search

Mixture Simulation

Mol to jpg conversion

Simulation: simulation_1

BMRB entry

ALATIS cross link

Gateway cross link

Download simulation data

View entry XML

Download entry NMR-STAR

Download entry NMReDATA

External links:

NMRFAM Servers

pKa (R. Williams)

1H NMR (Hans J. Reich)

4-[4-(3,4-Dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol

Simulation outputs:

InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/t11-,12+ Parameter Value
Field strength 499.84(MHz)
RMSD of the fit 0.02485
Temperature 298 K
pH 7.4
InChI InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/t11-,12+
Note 1 symmetric
Note 2 acetone 2.05
Note 3 coupling to 39 and 40 off

Sample description:

Compound Type Concentration
4-[4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol solute 100mM
Acetone-d6 solvent 100.0%
TMS reference 0.05%
Show/Hide Spin System Matrix

Spin System Matrix

23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40
23 0.813 -12.4 -12.4 0 0 0 0 0 0 0 0 0 0 0 0 0 6.645 0
24 0 0.813 -12.4 0 0 0 0 0 0 0 0 0 0 0 0 0 6.645 0
25 0 0 0.813 0 0 0 0 0 0 0 0 0 0 0 0 0 6.645 0
26 0 0 0 0.813 -12.4 -12.4 0 0 0 0 0 0 0 0 0 0 0 6.645
27 0 0 0 0 0.813 -12.4 0 0 0 0 0 0 0 0 0 0 0 6.645
28 0 0 0 0 0 0.813 0 0 0 0 0 0 0 0 0 0 0 6.645
29 0 0 0 0 0 0 6.517 0 8.06 0 0 0 0 0 2.531 0 0 0
30 0 0 0 0 0 0 0 6.517 0 8.06 0 0 0 0 0 2.531 0 0
31 0 0 0 0 0 0 0 0 6.728 0 0 0 0 0 0 0 0 0
32 0 0 0 0 0 0 0 0 0 6.728 0 0 0 0 0 0 0 0
33 0 0 0 0 0 0 0 0 0 0 2.198 -13.36 0 0 0 0 9.206 0
34 0 0 0 0 0 0 0 0 0 0 0 2.683 0 0 0 0 5.065 0
35 0 0 0 0 0 0 0 0 0 0 0 0 2.198 -13.36 0 0 0 9.206
36 0 0 0 0 0 0 0 0 0 0 0 0 0 2.683 0 0 0 5.065
37 0 0 0 0 0 0 0 0 0 0 0 0 0 0 6.679 0 0 0
38 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 6.679 0 0
39 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.723 0
40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.723

Spectra

Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale

Help

To zoom into a region, draw a box around it.
Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM Amplitude Peak Type
0.993024 standard
1.0 standard
0.0226809 standard
0.0693241 standard
0.039321 standard
0.0836472 standard
0.0936778 standard
0.0862367 standard
0.0843656 standard
0.0961438 standard
0.0891163 standard
0.0391372 standard
0.0755209 standard
0.0244381 standard
0.163003 standard
0.158079 standard
0.186166 standard
0.169079 standard
0.178294 standard
0.179777 standard
0.161638 standard
0.160216 standard
0.167175 standard
0.17467 standard
0.19533 standard
0.200069 standard
0.366936 standard
0.355807 standard
0.356873 standard
0.307132 standard
View GSD Peaks