2-Amino-6-chloropurine
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.02650 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C5H4ClN5/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H3,7,8,9,10,11) | |
Note 1 | peak at 6.78 may be N-H (DMSO solvent) |
Sample description:
Compound | Type | Concentration |
---|---|---|
2-Amino-6-chloropurine | Solute | 100mM |
DMSO | Solvent | 100% |
TMS | Reference | 0.05mM |
Spin System Matrix
12 | |
---|---|
12 | 8.113 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
8.11264 | 1.0 | standard |
-0.999459 | 2.0125e-05 | standard |
8.11264 | 1.0 | standard |
-0.980316 | 9.125e-06 | standard |
8.11264 | 1.0 | standard |
-0.921002 | 5.125e-06 | standard |
8.11264 | 1.0 | standard |
-0.905728 | 4.125e-06 | standard |
8.11264 | 1.0 | standard |
-0.785018 | 3.125e-06 | standard |
8.11264 | 1.0 | standard |
-0.578512 | 1.125e-06 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |
8.11264 | 1.0 | standard |