Succinic acid
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 600.13(MHz) | |
RMSD of the fit | 0.00897 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) | |
Note 1 | Oscar Li |
Sample description:
Compound | Type | Concentration |
---|---|---|
Succinic acid | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 1% |
Spin System Matrix
9 | 10 | 11 | 12 | |
---|---|---|---|---|
9 | 2.561 | -12.4 | 6.064 | 6.064 |
10 | 0 | 2.561 | 6.064 | 6.064 |
11 | 0 | 0 | 2.561 | -12.4 |
12 | 0 | 0 | 0 | 2.561 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |
2.56118 | 1.0 | standard |