Uracil
Simulation outputs:
|
Parameter | Value |
| Field strength | 600.13(MHz) | |
| RMSD of the fit | 0.01561 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) | |
| Note 1 | Oscar Li |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| Uracil | Solute | saturated solutionmM |
| D2O | Solvent | 100% |
| sodium phosphate | Buffer | 50mM |
| sodium azide | Cytocide | 500uM |
| DSS | Reference | 1% |
Spin System Matrix
| 9 | 10 | |
|---|---|---|
| 9 | 5.793 | 7.896 |
| 10 | 0 | 7.53 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 5.78633 | 1.0 | standard |
| 5.79952 | 1.0 | standard |
| 7.52338 | 1.0 | standard |
| 7.53657 | 1.0 | standard |
| -0.962363 | 8.125e-06 | standard |
| 5.68875 | 0.800635 | standard |
| 5.88609 | 1.0 | standard |
| 7.4369 | 1.0 | standard |
| 7.63424 | 0.800635 | standard |
| -0.970596 | 4.125e-06 | standard |
| 5.72474 | 0.862074 | standard |
| 5.85624 | 1.0 | standard |
| 7.46665 | 0.999988 | standard |
| 7.59825 | 0.862059 | standard |
| -0.825585 | 2.125e-06 | standard |
| 5.7422 | 0.894616 | standard |
| 5.84087 | 1.0 | standard |
| 7.48202 | 1.0 | standard |
| 7.58069 | 0.894616 | standard |
| -0.939352 | 2.125e-06 | standard |
| 5.74805 | 0.905745 | standard |
| 5.83571 | 1.0 | standard |
| 7.48718 | 0.999981 | standard |
| 7.57494 | 0.905723 | standard |
| -0.554906 | 1.125e-06 | standard |
| 5.75261 | 0.914748 | standard |
| 5.83155 | 1.0 | standard |
| 7.49144 | 1.0 | standard |
| 7.57038 | 0.914748 | standard |
| 5.77304 | 0.956414 | standard |
| 5.81251 | 1.0 | standard |
| 7.51048 | 1.0 | standard |
| 7.54995 | 0.956414 | standard |
| 5.77968 | 0.999928 | standard |
| 5.80606 | 0.999928 | standard |
| 7.51693 | 1.0 | standard |
| 7.54321 | 1.0 | standard |
| 5.78305 | 1.0 | standard |
| 5.80279 | 1.0 | standard |
| 7.5202 | 1.0 | standard |
| 7.53994 | 1.0 | standard |
| 5.78504 | 1.0 | standard |
| 5.8008 | 1.0 | standard |
| 7.52209 | 1.0 | standard |
| 7.53785 | 1.0 | standard |
| 5.78633 | 1.0 | standard |
| 5.79952 | 1.0 | standard |
| 7.52338 | 1.0 | standard |
| 7.53657 | 1.0 | standard |
| 5.78732 | 1.0 | standard |
| 5.79862 | 1.0 | standard |
| 7.52437 | 1.0 | standard |
| 7.53567 | 1.0 | standard |
| 5.78771 | 1.0 | standard |
| 5.79823 | 1.0 | standard |
| 7.52476 | 1.0 | standard |
| 7.53528 | 1.0 | standard |
| 5.78801 | 0.999807 | standard |
| 5.79793 | 0.999807 | standard |
| 7.52506 | 1.0 | standard |
| 7.53488 | 1.0 | standard |
| 5.78861 | 1.0 | standard |
| 5.79733 | 1.0 | standard |
| 7.52556 | 0.999783 | standard |
| 7.53438 | 0.999783 | standard |
| 5.78881 | 1.0 | standard |
| 5.79714 | 1.0 | standard |
| 7.52586 | 1.0 | standard |
| 7.53419 | 1.0 | standard |
| 5.789 | 0.999758 | standard |
| 5.79694 | 0.999758 | standard |
| 7.52605 | 1.0 | standard |
| 7.53389 | 1.0 | standard |
| 5.7894 | 1.0 | standard |
| 5.79654 | 1.0 | standard |
| 7.52635 | 0.999736 | standard |
| 7.53359 | 0.999736 | standard |
| 5.7899 | 0.99969 | standard |
| 5.79604 | 0.99969 | standard |
| 7.52695 | 1.0 | standard |
| 7.533 | 1.0 | standard |