4-Pyridoxic-acid
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.01530 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C8H9NO4/c1-4-7(11)6(8(12)13)5(3-10)2-9-4/h2,10-11H,3H2,1H3,(H,12,13) | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
4-Pyridoxic acid | Solute | saturatedmM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 0.1% |
Spin System Matrix
14 | 15 | 16 | 17 | 18 | 19 | |
---|---|---|---|---|---|---|
14 | 2.411 | -14.9 | -14.9 | 0 | 0 | 0 |
15 | 0 | 2.411 | -14.9 | 0 | 0 | 0 |
16 | 0 | 0 | 2.411 | 0 | 0 | 0 |
17 | 0 | 0 | 0 | 7.801 | 0 | 0 |
18 | 0 | 0 | 0 | 0 | 4.712 | -12.4 |
19 | 0 | 0 | 0 | 0 | 0 | 4.712 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.41131 | 1.0 | standard |
4.71184 | 0.666666 | standard |
7.80139 | 0.333333 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.66656 | standard |
7.80139 | 0.333266 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.66667 | standard |
7.80139 | 0.333329 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666673 | standard |
7.80139 | 0.332657 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666544 | standard |
7.80139 | 0.333214 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666529 | standard |
7.80139 | 0.333262 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666668 | standard |
7.80139 | 0.333333 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666737 | standard |
7.80139 | 0.333368 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.66661 | standard |
7.80139 | 0.333291 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666201 | standard |
7.80139 | 0.33324 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666667 | standard |
7.80139 | 0.333333 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666667 | standard |
7.80139 | 0.333333 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.6663 | standard |
7.80139 | 0.332818 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666145 | standard |
7.80139 | 0.333117 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666666 | standard |
7.80139 | 0.333333 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666662 | standard |
7.80139 | 0.333301 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666667 | standard |
7.80139 | 0.332845 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666079 | standard |
7.80139 | 0.333186 | standard |
2.41131 | 1.0 | standard |
4.71184 | 0.666667 | standard |
7.80139 | 0.333333 | standard |