Adenine
Simulation outputs:
|
Parameter | Value |
| Field strength | 600.13(MHz) | |
| RMSD of the fit | 0.00625 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10) | |
| Note 1 | Oscar Li |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| adenine | Solute | saturatedmM |
| D2O | Solvent | 100% |
| sodium phosphate | Buffer | 50mM |
| sodium azide | Cytocide | 500uM |
| DSS | Reference | 0.1% |
Spin System Matrix
| 11 | 12 | |
|---|---|---|
| 11 | 8.134 | 0 |
| 12 | 0 | 8.002 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| -0.984382 | 1.8125e-05 | standard |
| 8.00179 | 1.0 | standard |
| 8.13373 | 1.0 | standard |
| -0.940046 | 8.125e-06 | standard |
| 8.00176 | 1.0 | standard |
| 8.13376 | 1.0 | standard |
| -0.999657 | 5.125e-06 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| -0.983391 | 4.125e-06 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| -0.861391 | 3.125e-06 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| -0.651513 | 1.125e-06 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |
| 8.00175 | 1.0 | standard |
| 8.13377 | 1.0 | standard |