3-Methylsalicylaldehyde
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.01530 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C8H8O2/c1-6-3-2-4-7(5-9)8(6)10/h2-5,10H,1H3 | |
Note 1 | 15?16 |
Sample description:
Compound | Type | Concentration |
---|---|---|
3-Methylsalicylaldehyde | Solute | 100mM |
CDCl3 | Solvent | 100% |
TMS | Reference | 0.05mM |
Spin System Matrix
11 | 12 | 13 | 15 | 14 | 16 | 17 | |
---|---|---|---|---|---|---|---|
11 | 2.275 | -14.9 | -14.9 | 0.614 | 0 | 0 | 0 |
12 | 0 | 2.275 | -14.9 | 0.614 | 0 | 0 | 0 |
13 | 0 | 0 | 2.275 | 0.614 | 0 | 0 | 0 |
15 | 0 | 0 | 0 | 7.395 | 7.531 | 1.394 | 0 |
14 | 0 | 0 | 0 | 0 | 6.931 | 7.531 | 0 |
16 | 0 | 0 | 0 | 0 | 0 | 7.403 | 0.532 |
17 | 0 | 0 | 0 | 0 | 0 | 0 | 9.879 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.27461 | 1.00001 | standard |
6.91616 | 0.10847 | standard |
6.93123 | 0.222464 | standard |
6.94631 | 0.117829 | standard |
7.38862 | 0.118709 | standard |
7.38934 | 0.116472 | standard |
7.39422 | 0.146295 | standard |
7.39629 | 0.0900191 | standard |
7.40375 | 0.114325 | standard |
7.40917 | 0.134404 | standard |
9.87926 | 0.352352 | standard |