Rhodanine
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.00915 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C3H3NOS2/c5-2-1-7-3(6)4-2/h1H2,(H,4,5,6) | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
rhodanine | Solute | 100mM |
methanol | Solvent | 100% |
TMS | Reference | 0.05mM |
Spin System Matrix
8 | 9 | |
---|---|---|
8 | 4.17 | 0 |
9 | 0 | 4.17 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |
4.17018 | 1.0 | standard |