Pyromellitic-acid
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.00782 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C10H6O8/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
Pyromellitic acid | Solute | 100mM |
methanol | Solvent | 100% |
TMS | Reference | 0.05mM |
Spin System Matrix
19 | 20 | |
---|---|---|
19 | 8.036 | 0 |
20 | 0 | 8.036 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
8.03587 | 1.0 | standard |
-0.970496 | 1.8125e-05 | standard |
8.03587 | 1.0 | standard |
-0.935384 | 8.125e-06 | standard |
8.03587 | 1.0 | standard |
-0.997773 | 5.125e-06 | standard |
8.03587 | 1.0 | standard |
-0.982498 | 4.125e-06 | standard |
8.03587 | 1.0 | standard |
-0.861788 | 3.125e-06 | standard |
8.03587 | 1.0 | standard |
-0.655282 | 1.125e-06 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |
8.03587 | 1.0 | standard |