N-N-dimethylformamide
Simulation outputs:
|
Parameter | Value |
| Field strength | 499.84(MHz) | |
| RMSD of the fit | 0.02808 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3 | |
| pKa | -0.30 | |
| Note 1 | qm |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| N,N-dimethylformamide | Solute | Saturated1 |
| benzene | Solvent | 100% |
| TMS | Reference | 10mM |
Spin System Matrix
| 9 | 10 | 11 | 6 | 7 | 8 | 12 | |
|---|---|---|---|---|---|---|---|
| 9 | 1.879 | -12.5 | -12.5 | 0 | 0 | 0 | 0 |
| 10 | 0 | 1.879 | -12.5 | 0 | 0 | 0 | 0 |
| 11 | 0 | 0 | 1.879 | 0 | 0 | 0 | 0 |
| 6 | 0 | 0 | 0 | 2.376 | -12.5 | -12.5 | 0 |
| 7 | 0 | 0 | 0 | 0 | 2.376 | -12.5 | 0 |
| 8 | 0 | 0 | 0 | 0 | 0 | 2.376 | 0 |
| 12 | 0 | 0 | 0 | 0 | 0 | 0 | 7.656 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 1.87878 | 0.997859 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.332907 | standard |
| 1.87878 | 0.999561 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.332829 | standard |
| 1.87878 | 0.999036 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.332664 | standard |
| 1.87878 | 0.999727 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.332939 | standard |
| 1.87878 | 0.999834 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.333258 | standard |
| 1.87878 | 1.0 | standard |
| 2.3758 | 0.999611 | standard |
| 7.65599 | 0.333326 | standard |
| 1.87878 | 0.999681 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.33302 | standard |
| 1.87878 | 0.999284 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.333326 | standard |
| 1.87878 | 0.997993 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.332215 | standard |
| 1.87878 | 0.998085 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.333323 | standard |
| 1.87878 | 0.997134 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.333323 | standard |
| 1.87878 | 0.99618 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.333023 | standard |
| 1.87878 | 0.994866 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.332778 | standard |
| 1.87878 | 0.995124 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.333292 | standard |
| 1.87878 | 0.993996 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.333326 | standard |
| 1.87878 | 0.993344 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.333312 | standard |
| 1.87878 | 0.991984 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.33308 | standard |
| 1.87878 | 0.990819 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.332434 | standard |
| 1.87878 | 0.988107 | standard |
| 2.3758 | 1.0 | standard |
| 7.65599 | 0.333202 | standard |