2-6-Dichlorophenol
Simulation outputs:
|
Parameter | Value |
| Field strength | 499.84(MHz) | |
| RMSD of the fit | 0.01679 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C6H4Cl2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H | |
| Note 1 | benzene 7.1572 |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| 2,6-dichlorophenol | Solute | Saturated1 |
| benzene | Solvent | 100% |
| TMS | Reference | 10mM |
Spin System Matrix
| 10 | 11 | 12 | |
|---|---|---|---|
| 10 | 6.116 | 7.865 | 7.865 |
| 11 | 0 | 6.753 | 0 |
| 12 | 0 | 0 | 6.753 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 6.09996 | 0.237864 | standard |
| 6.11572 | 0.484296 | standard |
| 6.13149 | 0.261576 | standard |
| 6.74487 | 1.0 | standard |
| 6.76053 | 0.953271 | standard |
| -0.936674 | 6.125e-06 | standard |
| 5.89406 | 0.122766 | standard |
| 6.05869 | 0.205615 | standard |
| 6.11498 | 0.250636 | standard |
| 6.27874 | 0.37617 | standard |
| 6.67056 | 1.0 | standard |
| 6.84509 | 0.424851 | standard |
| 6.88002 | 0.383654 | standard |
| -0.928045 | 3.125e-06 | standard |
| 5.97291 | 0.154544 | standard |
| 6.09248 | 0.271961 | standard |
| 6.11373 | 0.289755 | standard |
| 6.23232 | 0.333837 | standard |
| 6.6943 | 1.0 | standard |
| 6.82188 | 0.577059 | standard |
| -0.950064 | 2.125e-06 | standard |
| 6.01066 | 0.173497 | standard |
| 6.11216 | 0.331233 | standard |
| 6.20604 | 0.311289 | standard |
| 6.70749 | 1.0 | standard |
| 6.80499 | 0.689366 | standard |
| -0.608962 | 1.125e-06 | standard |
| 6.02305 | 0.180396 | standard |
| 6.11137 | 0.35088 | standard |
| 6.19692 | 0.303789 | standard |
| 6.71212 | 1.0 | standard |
| 6.79897 | 0.728621 | standard |
| -0.678293 | 1.125e-06 | standard |
| 6.03276 | 0.185895 | standard |
| 6.11156 | 0.368789 | standard |
| 6.18939 | 0.297503 | standard |
| 6.71585 | 1.00002 | standard |
| 6.79411 | 0.757666 | standard |
| 6.07538 | 0.215923 | standard |
| 6.11469 | 0.447768 | standard |
| 6.15399 | 0.273657 | standard |
| 6.73361 | 1.00006 | standard |
| 6.77287 | 0.883353 | standard |
| 6.08916 | 0.227641 | standard |
| 6.11538 | 0.47 | standard |
| 6.1416 | 0.266658 | standard |
| 6.73976 | 1.00016 | standard |
| 6.76598 | 0.921314 | standard |
| 6.096 | 0.234075 | standard |
| 6.11562 | 0.479984 | standard |
| 6.13525 | 0.263573 | standard |
| 6.74293 | 1.00031 | standard |
| 6.76256 | 0.942236 | standard |
| 6.09996 | 0.237872 | standard |
| 6.11572 | 0.484347 | standard |
| 6.13139 | 0.261673 | standard |
| 6.74487 | 1.0 | standard |
| 6.76053 | 0.953285 | standard |
| 6.10264 | 0.240562 | standard |
| 6.11577 | 0.486907 | standard |
| 6.12891 | 0.260382 | standard |
| 6.7461 | 1.00075 | standard |
| 6.75924 | 0.95912 | standard |
| 6.10462 | 0.253437 | standard |
| 6.11582 | 0.494558 | standard |
| 6.12702 | 0.253436 | standard |
| 6.747 | 1.00102 | standard |
| 6.7583 | 0.984043 | standard |
| 6.10531 | 0.253545 | standard |
| 6.11582 | 0.494536 | standard |
| 6.12633 | 0.253544 | standard |
| 6.74739 | 1.00118 | standard |
| 6.7579 | 0.985324 | standard |
| 6.10601 | 0.253058 | standard |
| 6.11582 | 0.493166 | standard |
| 6.12564 | 0.253058 | standard |
| 6.74774 | 1.0 | standard |
| 6.75755 | 0.985157 | standard |
| 6.1071 | 0.255801 | standard |
| 6.11587 | 0.500892 | standard |
| 6.12455 | 0.255978 | standard |
| 6.74829 | 1.00173 | standard |
| 6.75701 | 1.00173 | standard |
| 6.10759 | 0.254922 | standard |
| 6.11587 | 0.498914 | standard |
| 6.12415 | 0.254922 | standard |
| 6.74848 | 0.997782 | standard |
| 6.75676 | 1.0 | standard |
| 6.10799 | 0.2549 | standard |
| 6.11587 | 0.498789 | standard |
| 6.12375 | 0.254899 | standard |
| 6.74868 | 0.997538 | standard |
| 6.75656 | 1.0 | standard |
| 6.10868 | 0.254867 | standard |
| 6.11587 | 0.49852 | standard |
| 6.12306 | 0.254867 | standard |
| 6.74903 | 1.0 | standard |
| 6.75622 | 0.997007 | standard |
| 6.10987 | 0.255048 | standard |
| 6.11587 | 0.497909 | standard |
| 6.12197 | 0.254794 | standard |
| 6.74962 | 1.0 | standard |
| 6.75567 | 1.0 | standard |