2-5-Dichlorohydroquinone
Simulation outputs:
|
Parameter | Value |
| Field strength | 499.84(MHz) | |
| RMSD of the fit | 0.00906 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C6H4Cl2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,9-10H | |
| Note 1 | acetone 2.0598 | |
| Note 2 | broad peaks -OH,H2O?? |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| 2,5-dichlorohydroquinone | Solute | Saturated1 |
| acetone | Solvent | 100% |
| TMS | Reference | 0.5% |
Spin System Matrix
| 11 | 12 | |
|---|---|---|
| 11 | 7.012 | 0 |
| 12 | 0 | 7.012 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 7.01177 | 1.0 | standard |
| -0.884601 | 3.125e-06 | standard |
| 7.01177 | 1.0 | standard |
| -0.444809 | 1.125e-06 | standard |
| 7.01177 | 1.0 | standard |
| -0.746633 | 1.125e-06 | standard |
| 7.01177 | 1.0 | standard |
| -0.892635 | 1.125e-06 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |
| 7.01177 | 1.0 | standard |