N-acetylglycine
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 400.13(MHz) | |
RMSD of the fit | 0.01696 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C4H7NO3/c1-3(6)5-2-4(7)8/h2H2,1H3,(H,5,6)(H,7,8) | |
pKa | 3.67 | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
n-acetylglycine | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
9 | 10 | 11 | 12 | 13 | |
---|---|---|---|---|---|
9 | 2.026 | -14.9 | -14.9 | 0 | 0 |
10 | 0 | 2.026 | -14.9 | 0 | 0 |
11 | 0 | 0 | 2.026 | 0 | 0 |
12 | 0 | 0 | 0 | 3.733 | -12.4 |
13 | 0 | 0 | 0 | 0 | 3.733 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.02567 | 1.0 | standard |
3.73327 | 0.666725 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.66552 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.667274 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.665708 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.664755 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.666702 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.666602 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.666971 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.664841 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.665797 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.666665 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.66341 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.666405 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.664385 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.665845 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.664003 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.665724 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.667206 | standard |
2.02567 | 1.0 | standard |
3.73327 | 0.666241 | standard |