N-acetylglycine
Simulation outputs:
                 
             | 
            Parameter | Value | 
| Field strength | 400.13(MHz) | |
| RMSD of the fit | 0.01696 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C4H7NO3/c1-3(6)5-2-4(7)8/h2H2,1H3,(H,5,6)(H,7,8) | |
| pKa | 3.67 | |
| Note 1 | None | 
Sample description:
| Compound | Type | Concentration | 
|---|---|---|
| n-acetylglycine | Solute | 100mM | 
| D2O | Solvent | 100% | 
| sodium phosphate | Buffer | 50mM | 
| sodium azide | Cytocide | 500uM | 
| DSS | Reference | 500uM | 
Spin System Matrix
| 9 | 10 | 11 | 12 | 13 | |
|---|---|---|---|---|---|
| 9 | 2.026 | -14.9 | -14.9 | 0 | 0 | 
| 10 | 0 | 2.026 | -14.9 | 0 | 0 | 
| 11 | 0 | 0 | 2.026 | 0 | 0 | 
| 12 | 0 | 0 | 0 | 3.733 | -12.4 | 
| 13 | 0 | 0 | 0 | 0 | 3.733 | 
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type | 
|---|---|---|
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.666725 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.66552 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.667274 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.665708 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.664755 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.666702 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.666602 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.666971 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.664841 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.665797 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.666665 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.66341 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.666405 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.664385 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.665845 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.664003 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.665724 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.667206 | standard | 
| 2.02567 | 1.0 | standard | 
| 3.73327 | 0.666241 | standard |