Syringic-acid
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.00958 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
syringic acid | Solute | Saturated1 |
DMSO | Solvent | 100% |
TMS | Reference | 0.01% |
Spin System Matrix
15 | 16 | 17 | 21 | 22 | 18 | 19 | 20 | |
---|---|---|---|---|---|---|---|---|
15 | 3.808 | -11.5 | -11.5 | 0 | 0 | 0 | 0 | 0 |
16 | 0 | 3.808 | -11.5 | 0 | 0 | 0 | 0 | 0 |
17 | 0 | 0 | 3.808 | 0 | 0 | 0 | 0 | 0 |
21 | 0 | 0 | 0 | 7.211 | 2.0 | 0 | 0 | 0 |
22 | 0 | 0 | 0 | 0 | 7.211 | 0 | 0 | 0 |
18 | 0 | 0 | 0 | 0 | 0 | 3.808 | -11.5 | -11.5 |
19 | 0 | 0 | 0 | 0 | 0 | 0 | 3.808 | -11.5 |
20 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.808 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
3.80805 | 1.0 | standard |
7.21094 | 0.332694 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332891 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.33295 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332752 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.333347 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.333094 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.33297 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.333241 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332724 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332966 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332602 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.333048 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332486 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332306 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.333029 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332862 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332961 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.332957 | standard |
3.80805 | 1.0 | standard |
7.21094 | 0.333041 | standard |