Acetosyringone
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.00257 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C10H12O4/c1-6(11)7-4-8(13-2)10(12)9(5-7)14-3/h4-5,12H,1-3H3 | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
acetosyringone | Solute | Saturated1 |
DMSO | Solvent | 100% |
TMS | Reference | 0.01% |
Spin System Matrix
15 | 16 | 17 | 24 | 25 | 18 | 19 | 20 | 21 | 22 | 23 | |
---|---|---|---|---|---|---|---|---|---|---|---|
15 | 2.528 | -14.9 | -14.9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
16 | 0 | 2.528 | -14.9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
17 | 0 | 0 | 2.528 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
24 | 0 | 0 | 0 | 7.232 | 2.0 | 0 | 0 | 0 | 0 | 0 | 0 |
25 | 0 | 0 | 0 | 0 | 7.232 | 0 | 0 | 0 | 0 | 0 | 0 |
18 | 0 | 0 | 0 | 0 | 0 | 3.828 | -11.5 | -11.5 | 0 | 0 | 0 |
19 | 0 | 0 | 0 | 0 | 0 | 0 | 3.828 | -11.5 | 0 | 0 | 0 |
20 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.828 | 0 | 0 | 0 |
21 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.828 | -11.5 | -11.5 |
22 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.828 | -11.5 |
23 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.828 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.52795 | 0.513187 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341622 | standard |
2.52795 | 0.513877 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.342293 | standard |
2.52795 | 0.513767 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341886 | standard |
2.52795 | 0.513427 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341978 | standard |
2.52795 | 0.513146 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.342178 | standard |
2.52795 | 0.51399 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341269 | standard |
2.52795 | 0.512937 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.342038 | standard |
2.52795 | 0.51297 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341913 | standard |
2.52795 | 0.513498 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341339 | standard |
2.52795 | 0.512705 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.342105 | standard |
2.52795 | 0.512633 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.342158 | standard |
2.52795 | 0.513069 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341709 | standard |
2.52795 | 0.512722 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.342052 | standard |
2.52795 | 0.513137 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341632 | standard |
2.52795 | 0.512938 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341823 | standard |
2.52795 | 0.512998 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.34176 | standard |
2.52795 | 0.512974 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.341781 | standard |
2.52795 | 0.512629 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.342121 | standard |
2.52795 | 0.512721 | standard |
3.82809 | 1.0 | standard |
7.23246 | 0.342021 | standard |