3-Hydroxy-2-methyl-4-pyrone
Simulation outputs:
|
Parameter | Value |
| Field strength | 400.13(MHz) | |
| RMSD of the fit | 0.00764 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C6H6O3/c1-4-6(8)5(7)2-3-9-4/h2-3,8H,1H3 | |
| Note 1 | 13?14 |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| 3-hydroxy-2-methyl-4-pyrone | Solute | Saturated1 |
| CDCl3 | Solvent | 100% |
| TMS | Reference | 0.5% |
Spin System Matrix
| 10 | 11 | 12 | 13 | 14 | |
|---|---|---|---|---|---|
| 10 | 2.373 | -14.9 | -14.9 | 0 | 0 |
| 11 | 0 | 2.373 | -14.9 | 0 | 0 |
| 12 | 0 | 0 | 2.373 | 0 | 0 |
| 13 | 0 | 0 | 0 | 6.426 | 5.173 |
| 14 | 0 | 0 | 0 | 0 | 7.711 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 2.37283 | 1.0 | standard |
| 6.41965 | 0.172619 | standard |
| 6.43261 | 0.172621 | standard |
| 7.7049 | 0.172683 | standard |
| 7.71776 | 0.172708 | standard |
| 2.37283 | 1.0 | standard |
| 6.35844 | 0.156643 | standard |
| 6.48744 | 0.188877 | standard |
| 7.64997 | 0.188867 | standard |
| 7.77897 | 0.156643 | standard |
| 2.37283 | 1.0 | standard |
| 6.38177 | 0.161936 | standard |
| 6.46773 | 0.182578 | standard |
| 7.66977 | 0.183268 | standard |
| 7.75574 | 0.161252 | standard |
| 2.37283 | 1.0 | standard |
| 6.39314 | 0.164905 | standard |
| 6.45764 | 0.180961 | standard |
| 7.67987 | 0.180864 | standard |
| 7.74437 | 0.164894 | standard |
| 2.37283 | 1.0 | standard |
| 6.3969 | 0.166094 | standard |
| 6.45418 | 0.179053 | standard |
| 7.68323 | 0.179253 | standard |
| 7.74061 | 0.165967 | standard |
| 2.37283 | 1.0 | standard |
| 6.39986 | 0.166709 | standard |
| 6.45141 | 0.17782 | standard |
| 7.686 | 0.178545 | standard |
| 7.73764 | 0.165563 | standard |
| 2.37283 | 1.0 | standard |
| 6.41312 | 0.171838 | standard |
| 6.43894 | 0.173469 | standard |
| 7.69857 | 0.17351 | standard |
| 7.72429 | 0.171886 | standard |
| 2.37283 | 1.0 | standard |
| 6.41747 | 0.172602 | standard |
| 6.43468 | 0.172664 | standard |
| 7.70273 | 0.172601 | standard |
| 7.71994 | 0.171251 | standard |
| 2.37283 | 1.0 | standard |
| 6.41965 | 0.17262 | standard |
| 6.43261 | 0.172624 | standard |
| 7.7049 | 0.172708 | standard |
| 7.71776 | 0.172713 | standard |
| 2.37283 | 1.0 | standard |
| 6.42093 | 0.172594 | standard |
| 6.43132 | 0.172493 | standard |
| 7.70619 | 0.172706 | standard |
| 7.71648 | 0.172594 | standard |
| 2.37283 | 1.0 | standard |
| 6.42182 | 0.172578 | standard |
| 6.43043 | 0.172435 | standard |
| 7.70698 | 0.172666 | standard |
| 7.71559 | 0.172611 | standard |
| 2.37283 | 1.0 | standard |
| 6.42242 | 0.172433 | standard |
| 6.42984 | 0.172584 | standard |
| 7.70757 | 0.172451 | standard |
| 7.71499 | 0.172587 | standard |
| 2.37283 | 1.0 | standard |
| 6.42271 | 0.172721 | standard |
| 6.42954 | 0.171709 | standard |
| 7.70787 | 0.172721 | standard |
| 7.7147 | 0.171709 | standard |
| 2.37283 | 1.0 | standard |
| 6.42291 | 0.172606 | standard |
| 6.42934 | 0.172706 | standard |
| 7.70807 | 0.172705 | standard |
| 7.7145 | 0.172603 | standard |
| 2.37283 | 1.0 | standard |
| 6.42331 | 0.172527 | standard |
| 6.42904 | 0.172635 | standard |
| 7.70846 | 0.17149 | standard |
| 7.7142 | 0.171316 | standard |
| 2.37283 | 1.0 | standard |
| 6.42341 | 0.172597 | standard |
| 6.42885 | 0.172365 | standard |
| 7.70856 | 0.172354 | standard |
| 7.714 | 0.172626 | standard |
| 2.37283 | 1.0 | standard |
| 6.4236 | 0.172673 | standard |
| 6.42875 | 0.171754 | standard |
| 7.70876 | 0.172618 | standard |
| 7.71391 | 0.171655 | standard |
| 2.37283 | 1.0 | standard |
| 6.4238 | 0.171454 | standard |
| 6.42845 | 0.171676 | standard |
| 7.70896 | 0.172021 | standard |
| 7.71361 | 0.172694 | standard |
| 2.37283 | 1.0 | standard |
| 6.4242 | 0.171716 | standard |
| 6.42815 | 0.171782 | standard |
| 7.70935 | 0.171028 | standard |
| 7.71331 | 0.172065 | standard |