Hypotaurine
Simulation outputs:
|
Parameter | Value |
| Field strength | 499.84(MHz) | |
| RMSD of the fit | 0.02063 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C2H7NO2S/c3-1-2-6(4)5/h1-3H2,(H,4,5) | |
| pKa | -0.36StrongestAcidic(HMDB00965) | |
| pKa | 9.64StrongestBasic(HMDB00965) | |
| Note 1 | 7,8?9,10 |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| Hypotaurine | Solute | 100mM |
| D2O | Solvent | 100% |
| sodium phosphate | Buffer | 50mM |
| sodium azide | Cytocide | 500uM |
| DSS | Reference | 500uM |
Spin System Matrix
| 7 | 8 | 9 | 10 | |
|---|---|---|---|---|
| 7 | 3.342 | -12.413 | 6.962 | 6.713 |
| 8 | 0 | 3.343 | 6.952 | 6.772 |
| 9 | 0 | 0 | 2.633 | -12.414 |
| 10 | 0 | 0 | 0 | 2.634 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 2.61967 | 0.504634 | standard |
| 2.63334 | 0.999282 | standard |
| 2.64706 | 0.527175 | standard |
| 3.32865 | 0.525655 | standard |
| 3.34235 | 1.00013 | standard |
| 3.35599 | 0.504598 | standard |
| 2.42812 | 0.290208 | standard |
| 2.46696 | 0.330202 | standard |
| 2.62865 | 1.0 | standard |
| 2.78248 | 0.89464 | standard |
| 3.19319 | 0.894701 | standard |
| 3.34705 | 0.999372 | standard |
| 3.50881 | 0.330343 | standard |
| 3.54751 | 0.290477 | standard |
| 2.51681 | 0.378096 | standard |
| 2.62844 | 0.999628 | standard |
| 2.73717 | 0.761205 | standard |
| 3.23849 | 0.761236 | standard |
| 3.34725 | 1.0 | standard |
| 3.45901 | 0.378751 | standard |
| 2.54406 | 0.411649 | standard |
| 2.62927 | 0.999482 | standard |
| 2.71332 | 0.681376 | standard |
| 3.26244 | 0.681463 | standard |
| 3.34641 | 1.0 | standard |
| 3.4316 | 0.411689 | standard |
| 2.55414 | 0.422069 | standard |
| 2.62989 | 1.0 | standard |
| 2.70501 | 0.656578 | standard |
| 3.27065 | 0.656605 | standard |
| 3.34577 | 0.999935 | standard |
| 3.42153 | 0.422098 | standard |
| 2.56227 | 0.430144 | standard |
| 2.63046 | 1.00001 | standard |
| 2.6983 | 0.638204 | standard |
| 3.27741 | 0.636775 | standard |
| 3.34525 | 0.999642 | standard |
| 3.41339 | 0.430203 | standard |
| 2.59853 | 0.468726 | standard |
| 2.63268 | 1.00001 | standard |
| 2.66683 | 0.566854 | standard |
| 3.30889 | 0.565369 | standard |
| 3.34301 | 0.99573 | standard |
| 3.37718 | 0.469985 | standard |
| 2.61031 | 0.483331 | standard |
| 2.63313 | 0.997876 | standard |
| 2.65593 | 0.54744 | standard |
| 3.31973 | 0.547304 | standard |
| 3.34257 | 1.0 | standard |
| 3.36535 | 0.483386 | standard |
| 2.6162 | 0.490527 | standard |
| 2.6333 | 1.00002 | standard |
| 2.65043 | 0.538988 | standard |
| 3.32533 | 0.538978 | standard |
| 3.34242 | 1.00013 | standard |
| 3.35951 | 0.491968 | standard |
| 2.61967 | 0.504639 | standard |
| 2.63334 | 0.999367 | standard |
| 2.64701 | 0.525958 | standard |
| 3.32865 | 0.525642 | standard |
| 3.34235 | 1.00013 | standard |
| 3.35599 | 0.504591 | standard |
| 2.622 | 0.506385 | standard |
| 2.63339 | 0.999837 | standard |
| 2.64478 | 0.522131 | standard |
| 3.33088 | 0.521748 | standard |
| 3.3423 | 1.00019 | standard |
| 3.35367 | 0.506274 | standard |
| 2.62363 | 0.5146 | standard |
| 2.63344 | 1.00104 | standard |
| 2.6432 | 0.513368 | standard |
| 3.33252 | 0.514464 | standard |
| 3.3423 | 0.998505 | standard |
| 3.35203 | 0.514649 | standard |
| 2.62432 | 0.514833 | standard |
| 2.63344 | 1.00119 | standard |
| 2.64255 | 0.514963 | standard |
| 3.33311 | 0.514266 | standard |
| 3.34227 | 0.998995 | standard |
| 3.35139 | 0.512649 | standard |
| 2.62492 | 0.514988 | standard |
| 2.63344 | 1.00135 | standard |
| 2.64196 | 0.515127 | standard |
| 3.3337 | 0.514349 | standard |
| 3.34227 | 0.998872 | standard |
| 3.35079 | 0.512501 | standard |
| 2.62581 | 0.514654 | standard |
| 2.63344 | 1.00111 | standard |
| 2.64107 | 0.514812 | standard |
| 3.33465 | 0.515215 | standard |
| 3.34225 | 1.00042 | standard |
| 3.34985 | 0.514274 | standard |
| 2.62626 | 0.516011 | standard |
| 2.63344 | 1.00138 | standard |
| 2.64067 | 0.514878 | standard |
| 3.33504 | 0.515301 | standard |
| 3.34225 | 1.00047 | standard |
| 3.34946 | 0.514253 | standard |
| 2.6266 | 0.51495 | standard |
| 2.63344 | 1.00152 | standard |
| 2.64027 | 0.515125 | standard |
| 3.33539 | 0.514165 | standard |
| 3.34225 | 1.00051 | standard |
| 3.34906 | 0.514428 | standard |
| 2.62725 | 0.516588 | standard |
| 2.63344 | 1.00129 | standard |
| 2.63968 | 0.515124 | standard |
| 3.33603 | 0.51565 | standard |
| 3.34225 | 1.00062 | standard |
| 3.34847 | 0.514249 | standard |
| 2.62819 | 0.512167 | standard |
| 2.63349 | 1.0 | standard |
| 2.63874 | 0.514683 | standard |
| 3.33692 | 0.512929 | standard |
| 3.34222 | 0.994099 | standard |
| 3.34748 | 0.511397 | standard |