5-Hydroxymethyluracil
Simulation outputs:
|
Parameter | Value |
| Field strength | 499.84(MHz) | |
| RMSD of the fit | 0.00532 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C5H6N2O3/c8-2-3-1-6-5(10)7-4(3)9/h1,8H,2H2,(H2,6,7,9,10) | |
| Note 1 | None |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| 5-(Hydroxymethyl)uracil | Solute | SaturatedmM |
| D2O | Solvent | 100% |
| sodium phosphate | Buffer | 50mM |
| sodium azide | Cytocide | 500uM |
| DSS | Reference | 500uM |
Spin System Matrix
| 11 | 12 | 13 | |
|---|---|---|---|
| 11 | 7.576 | 0 | 0 |
| 12 | 0 | 4.343 | -12.4 |
| 13 | 0 | 0 | 4.343 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.500031 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.500014 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.500008 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.500006 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.500005 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.500001 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.500001 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |
| 4.34297 | 1.0 | standard |
| 7.57624 | 0.5 | standard |