5-Methylcytosine
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | None | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C5H7N3O/c1-3-2-7-5(9)8-4(3)6/h2H,1H3,(H3,6,7,8,9) | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
5-METHYLCYTOSINE | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
10 | 11 | 12 | 13 | |
---|---|---|---|---|
10 | 1.913 | -14.9 | -14.9 | 0 |
11 | 0 | 1.913 | -14.9 | 0 |
12 | 0 | 0 | 1.913 | 0 |
13 | 0 | 0 | 0 | 7.313 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
1.9127 | 1.0 | standard |
7.3126 | 0.333248 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.332366 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.331936 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.333259 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.33245 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.333305 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.331452 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.333333 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.333333 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.333372 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.333333 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.330538 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.333272 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.333333 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.333496 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.330706 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.332561 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.331185 | standard |
1.9127 | 1.0 | standard |
7.3126 | 0.330009 | standard |