Gallic-acid
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.00977 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12) | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
Gallic acid | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
13 | 14 | |
---|---|---|
13 | 7.048 | 2.0 |
14 | 0 | 7.048 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
7.04817 | 1.0 | standard |
-0.984283 | 6.125e-06 | standard |
7.04817 | 1.0 | standard |
-0.999955 | 3.125e-06 | standard |
7.04817 | 1.0 | standard |
-0.403547 | 1.125e-06 | standard |
7.04817 | 1.0 | standard |
-0.517512 | 1.125e-06 | standard |
7.04817 | 1.0 | standard |
-0.62989 | 1.125e-06 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |
7.04817 | 1.0 | standard |