DL-3-aminoisobutyric acid
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.00641 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1 | |
Note 1 | Oscar Li |
Sample description:
Compound | Type | Concentration |
---|---|---|
DL-3-aminoisobutyric acid | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
8 | 9 | 10 | 11 | 12 | 13 | |
---|---|---|---|---|---|---|
8 | 1.18 | 0 | -12.4 | 0 | 0 | 7.282 |
9 | 0 | 1.18 | 0 | 0 | 0 | 7.282 |
10 | 0 | 0 | 1.18 | 0 | 0 | 7.282 |
11 | 0 | 0 | 0 | 3.016 | -12.769 | 5.135 |
12 | 0 | 0 | 0 | 0 | 3.087 | 8.781 |
13 | 0 | 0 | 0 | 0 | 0 | 2.592 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
1.17288 | 1.00003 | standard |
1.18745 | 0.999934 | standard |
2.55646 | 0.0231009 | standard |
2.57107 | 0.0773749 | standard |
2.58178 | 0.091917 | standard |
2.58551 | 0.113926 | standard |
2.58767 | 0.103663 | standard |
2.59882 | 0.115564 | standard |
2.60254 | 0.0938553 | standard |
2.61324 | 0.0806591 | standard |
2.62789 | 0.0256323 | standard |
2.99544 | 0.113069 | standard |
3.00583 | 0.120119 | standard |
3.02102 | 0.23597 | standard |
3.03141 | 0.225155 | standard |
3.06783 | 0.232599 | standard |
3.08529 | 0.220637 | standard |
3.09333 | 0.124482 | standard |
3.11077 | 0.110665 | standard |