Hydroquinone
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 400.13(MHz) | |
RMSD of the fit | 0.01338 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
Hydroquinone | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
9 | 10 | 11 | 12 | |
---|---|---|---|---|
9 | 6.806 | 7.5 | 0.1 | 2.0 |
10 | 0 | 6.806 | 2.0 | 0.1 |
11 | 0 | 0 | 6.806 | 7.5 |
12 | 0 | 0 | 0 | 6.806 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
6.80596 | 1.0 | standard |
-0.953436 | 4.125e-06 | standard |
6.80596 | 1.0 | standard |
-0.932111 | 2.125e-06 | standard |
6.80596 | 1.0 | standard |
-0.658754 | 1.125e-06 | standard |
6.80596 | 1.0 | standard |
-0.774207 | 1.125e-06 | standard |
6.80596 | 1.0 | standard |
-0.887973 | 1.125e-06 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |
6.80596 | 1.0 | standard |