2-Amino-5-ethyl-1,3,4-thiadiazole
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 400.13(MHz) | |
RMSD of the fit | 0.02072 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C4H7N3S/c1-2-3-6-7-4(5)8-3/h2H2,1H3,(H2,5,7) | |
Note 1 | Oscar Li |
Sample description:
Compound | Type | Concentration |
---|---|---|
1,3,4-THIADIAZOLE, 2-AMINO-5-ETHYL- | Solute | Saturated1 |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
9 | 10 | 11 | 12 | 13 | |
---|---|---|---|---|---|
9 | 1.275 | 0.0 | 0.0 | 7.903 | 7.903 |
10 | 0 | 1.275 | 0.0 | 7.903 | 7.903 |
11 | 0 | 0 | 1.275 | 7.903 | 7.903 |
12 | 0 | 0 | 0 | 2.886 | 0.0 |
13 | 0 | 0 | 0 | 0 | 2.886 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
1.25539 | 0.508831 | standard |
1.27512 | 1.00002 | standard |
1.29483 | 0.515509 | standard |
2.85688 | 0.175586 | standard |
2.87665 | 0.499362 | standard |
2.89639 | 0.505279 | standard |
2.9161 | 0.176123 | standard |