L-tartaric-acid
Simulation outputs:
|
Parameter | Value |
| Field strength | 400.13(MHz) | |
| RMSD of the fit | 0.01278 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10) | |
| pKa | 2.98 | |
| pKa | 4.34 | |
| Note 1 | None |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| (R,R)-Tartaric acid | Solute | 100mM |
| D2O | Solvent | 100% |
| sodium phosphate | Buffer | 50mM |
| sodium azide | Cytocide | 500uM |
| DSS | Reference | 500uM |
Spin System Matrix
| 11 | 12 | |
|---|---|---|
| 11 | 4.325 | 7.0 |
| 12 | 0 | 4.325 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |
| 4.32501 | 1.0 | standard |