Sarcosine
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 400.13(MHz) | |
RMSD of the fit | 0.00426 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) | |
pKa | 2.21 | |
pKa | 10.1 | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
Sarcosine | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
7 | 8 | 9 | 10 | 11 | |
---|---|---|---|---|---|
7 | 2.726 | -12.5 | -12.5 | 0 | 0 |
8 | 0 | 2.726 | -12.5 | 0 | 0 |
9 | 0 | 0 | 2.726 | 0 | 0 |
10 | 0 | 0 | 0 | 3.601 | -12.904 |
11 | 0 | 0 | 0 | 0 | 3.601 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.72563 | 1.0 | standard |
3.60155 | 0.666277 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.667089 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.667013 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.666512 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.666586 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.664594 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.665556 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.665373 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.665275 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.666669 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.666658 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.666463 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.665335 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.666192 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.665278 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.667994 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.665931 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.665392 | standard |
2.72563 | 1.0 | standard |
3.60155 | 0.666667 | standard |