Creatinine
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.01304 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C4H7N3O/c1-7-2-3(8)6-4(7)5/h2H2,1H3,(H2,5,6,8) | |
pKa | 4.8 | |
pKa | 9.2 | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
Creatinine | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
9 | 10 | 11 | 12 | 13 | |
---|---|---|---|---|---|
9 | 3.034 | -12.5 | -12.5 | 0 | 0 |
10 | 0 | 3.034 | -12.5 | 0 | 0 |
11 | 0 | 0 | 3.034 | 0 | 0 |
12 | 0 | 0 | 0 | 4.042 | -19.22 |
13 | 0 | 0 | 0 | 0 | 4.042 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
3.034 | 1.0 | standard |
4.04203 | 0.665746 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666791 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666052 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666711 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666312 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666497 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666039 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.664515 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666574 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.665724 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.667402 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.665653 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.665598 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666839 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666179 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.665574 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666324 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.665576 | standard |
3.034 | 1.0 | standard |
4.04203 | 0.666567 | standard |