ADA
Simulation outputs:
                 
             | 
            Parameter | Value | 
| Field strength | 400.13(MHz) | |
| RMSD of the fit | 0.00402 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C6H10N2O5/c7-4(9)1-8(2-5(10)11)3-6(12)13/h1-3H2,(H2,7,9)(H,10,11)(H,12,13) | |
| Note 1 | None | 
Sample description:
| Compound | Type | Concentration | 
|---|---|---|
| Carbamoylmethylaminodiacetic acid | Solute | 100mM | 
| D2O | Solvent | 100% | 
| sodium phosphate | Buffer | 50mM | 
| sodium azide | Cytocide | 500uM | 
| DSS | Reference | 500uM | 
Spin System Matrix
| 14 | 15 | 16 | 17 | 18 | 19 | |
|---|---|---|---|---|---|---|
| 14 | 3.523 | -12.4 | 0 | 0 | 0 | 0 | 
| 15 | 0 | 3.523 | 0 | 0 | 0 | 0 | 
| 16 | 0 | 0 | 3.407 | -12.4 | 0 | 0 | 
| 17 | 0 | 0 | 0 | 3.407 | 0 | 0 | 
| 18 | 0 | 0 | 0 | 0 | 3.407 | -12.4 | 
| 19 | 0 | 0 | 0 | 0 | 0 | 3.407 | 
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type | 
|---|---|---|
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.501249 | standard | 
| 3.40709 | 1.0 | standard | 
| 3.52127 | 0.556167 | standard | 
| 3.40682 | 1.0 | standard | 
| 3.52239 | 0.525875 | standard | 
| 3.40677 | 1.0 | standard | 
| 3.5226 | 0.515514 | standard | 
| 3.40676 | 1.0 | standard | 
| 3.52263 | 0.511722 | standard | 
| 3.40676 | 1.0 | standard | 
| 3.52265 | 0.509719 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.502532 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.500767 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.500559 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.499536 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.500041 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.500597 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.500049 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.500065 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.500066 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.500171 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.499991 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.500053 | standard | 
| 3.40675 | 1.0 | standard | 
| 3.52269 | 0.499218 | standard |