Scyllo-inositol
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 400.13(MHz) | |
RMSD of the fit | 0.00335 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H | |
pKa | 12.29StrongestAcidic(Scyllitol@HMDB06088) | |
pKa | -3.6StrongestBasic(Scyllitol@HMDB06088) | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
scyllo-Inositol | Solute | Saturated1 |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
13 | 14 | 15 | 16 | 17 | 18 | |
---|---|---|---|---|---|---|
13 | 3.333 | 7.0 | 0 | 0 | 0 | 7.0 |
14 | 0 | 3.333 | 7.0 | 0 | 0 | 0 |
15 | 0 | 0 | 3.333 | 7.0 | 0 | 0 |
16 | 0 | 0 | 0 | 3.333 | 7.0 | 0 |
17 | 0 | 0 | 0 | 0 | 3.333 | 7.0 |
18 | 0 | 0 | 0 | 0 | 0 | 3.333 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |
3.33305 | 1.0 | standard |