Guanosine
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.00850 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-,9-/m1/s1 | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
Guanosine | Solute | saturatedmM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 0.1% |
Spin System Matrix
23 | 27 | 26 | 25 | 24 | 21 | 22 | |
---|---|---|---|---|---|---|---|
23 | 7.849 | 0 | 0 | 0 | 0 | 0 | 0 |
27 | 0 | 5.869 | 6.876 | 0 | 0 | 0 | 0 |
26 | 0 | 0 | 4.796 | 5.2 | 0 | 0 | 0 |
25 | 0 | 0 | 0 | 4.404 | 2.6 | 0 | 0 |
24 | 0 | 0 | 0 | 0 | 4.265 | 3.289 | 2.526 |
21 | 0 | 0 | 0 | 0 | 0 | 3.811 | -12.991 |
22 | 0 | 0 | 0 | 0 | 0 | 0 | 3.89 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
3.79269 | 0.181717 | standard |
3.79922 | 0.181717 | standard |
3.81868 | 0.342705 | standard |
3.8252 | 0.343318 | standard |
3.87701 | 0.350974 | standard |
3.88202 | 0.352378 | standard |
3.903 | 0.187141 | standard |
3.90801 | 0.185294 | standard |
4.25664 | 0.148793 | standard |
4.26196 | 0.34196 | standard |
4.26804 | 0.346459 | standard |
4.27337 | 0.158406 | standard |
4.39576 | 0.274751 | standard |
4.40094 | 0.27147 | standard |
4.40615 | 0.30136 | standard |
4.41128 | 0.271153 | standard |
4.78425 | 0.264022 | standard |
4.79473 | 0.286939 | standard |
4.79797 | 0.297972 | standard |
4.80844 | 0.251085 | standard |
5.8623 | 0.504881 | standard |
5.87609 | 0.504882 | standard |
7.8492 | 1.0 | standard |