Guanine
Simulation outputs:
|
Parameter | Value |
| Field strength | 400.13(MHz) | |
| RMSD of the fit | 0.00389 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11) | |
| Note 1 | None |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| Guanine | Solute | Saturated1 |
| D2O | Solvent | 100% |
| DSS | Reference | 500uM |
Spin System Matrix
| 12 | |
|---|---|
| 12 | 7.599 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 7.59905 | 1.0 | standard |
| -0.93836 | 1.1125e-05 | standard |
| 7.59905 | 1.0 | standard |
| -0.907116 | 5.125e-06 | standard |
| 7.59905 | 1.0 | standard |
| -0.896602 | 3.125e-06 | standard |
| 7.59905 | 1.0 | standard |
| -0.671945 | 2.125e-06 | standard |
| 7.59905 | 1.0 | standard |
| -0.842149 | 2.125e-06 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |
| 7.59905 | 1.0 | standard |