Glycine
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 499.84(MHz) | |
RMSD of the fit | 0.01828 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) | |
pKa | 2.35 | |
pKa | 9.78 | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
Glycine | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
6 | 7 | |
---|---|---|
6 | 3.544 | -12.4 |
7 | 0 | 3.544 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |
3.54432 | 1.0 | standard |