Fumaric-acid
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 400.13(MHz) | |
RMSD of the fit | 0.00913 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ | |
pKa | 3.02 | |
pKa | 4.38 | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
Fumarate | Solute | 100mM |
D2O | Solvent | 100% |
sodium phosphate | Buffer | 50mM |
sodium azide | Cytocide | 500uM |
DSS | Reference | 500uM |
Spin System Matrix
9 | 10 | |
---|---|---|
9 | 6.508 | 0 |
10 | 0 | 6.508 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
6.508 | 1.0 | standard |
-0.894222 | 4.125e-06 | standard |
6.508 | 1.0 | standard |
-0.878451 | 2.125e-06 | standard |
6.508 | 1.0 | standard |
-0.67869 | 1.125e-06 | standard |
6.508 | 1.0 | standard |
-0.762602 | 1.125e-06 | standard |
6.508 | 1.0 | standard |
-0.845918 | 1.125e-06 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |
6.508 | 1.0 | standard |