5-Fluoro-1,2-dihydropyrimidin-2-one
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 600.01(MHz) | |
RMSD of the fit | 0.12009 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C4H3FN2O/c5-3-1-6-4(8)7-2-3/h1-2H,(H,6,7,8) | |
Note 1 | no 19F coupling? | |
Note 2 | 9,10 broad |
Sample description:
Compound | Type | Concentration |
---|---|---|
5-Fluoro-1,2-dihydropyrimidin-2-one | Solute | 75uM |
DSS | Reference | 15uM |
bis-Tris-d19 | Buffer | 11mM |
NaCl | . | 150mM |
NaN3 | . | 0.04%. |
Na Formate | . | 200uM |
Spin System Matrix
9 | 10 | |
---|---|---|
9 | 8.306 | 1.5 |
10 | 0 | 8.306 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |
8.30615 | 1.0 | standard |