4-Hydroxy-3,5-dimethylbenzonitrile
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 600.01(MHz) | |
RMSD of the fit | 0.03602 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C9H9NO/c1-6-3-8(5-10)4-7(2)9(6)11/h3-4,11H,1-2H3 | |
Note 1 | None |
Sample description:
Compound | Type | Concentration |
---|---|---|
4-Hydroxy-3,5-dimethylbenzonitrile | Solute | 75uM |
DSS | Reference | 15uM |
bis-Tris-d19 | Buffer | 11mM |
NaCl | . | 150mM |
NaN3 | . | 0.04%. |
Na Formate | . | 200uM |
Spin System Matrix
12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | |
---|---|---|---|---|---|---|---|---|
12 | 2.215 | -14.0 | -14.0 | 0 | 0 | 0 | 0 | 0 |
13 | 0 | 2.215 | -14.0 | 0 | 0 | 0 | 0 | 0 |
14 | 0 | 0 | 2.215 | 0 | 0 | 0 | 0 | 0 |
15 | 0 | 0 | 0 | 2.215 | -14.0 | -14.0 | 0 | 0 |
16 | 0 | 0 | 0 | 0 | 2.215 | -14.0 | 0 | 0 |
17 | 0 | 0 | 0 | 0 | 0 | 2.215 | 0 | 0 |
18 | 0 | 0 | 0 | 0 | 0 | 0 | 7.419 | 1.5 |
19 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 7.419 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.21532 | 1.0 | standard |
7.41883 | 0.332731 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332961 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332687 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332684 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332861 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332887 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332885 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332952 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332809 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332648 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332773 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.333264 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332734 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.332972 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.333171 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.333035 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.333053 | standard |
2.21532 | 1.0 | standard |
7.41883 | 0.333087 | standard |