Guided Ideographic Spin System Model Optimization

Global links:

GISSMO Home

GISSMO Library

GISSMO Tutorial

GISSMO-GUI

Web Services:

Peak Search

Mixture Simulation

Mol to jpg conversion

Simulation: simulation_1

Gateway cross link

Download simulation data

View entry XML

Download entry NMR-STAR

Download entry NMReDATA

External links:

NMRFAM Servers

pKa (R. Williams)

1H NMR (Hans J. Reich)

3-[(2-Hydroxyethyl)thio]-6,6-dimethyl-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carbonitrile

Simulation outputs:

InChI=1S/C13H15NO2S2/c1-13(2)5-8-10(7-14)18-12(17-4-3-15)11(8)9(16)6-13/h15H,3-6H2,1-2H3 Parameter Value
Field strength 600.01(MHz)
RMSD of the fit 0.01278
Temperature 298 K
pH 7.4
InChI InChI=1S/C13H15NO2S2/c1-13(2)5-8-10(7-14)18-12(17-4-3-15)11(8)9(16)6-13/h15H,3-6H2,1-2H3
Note 1 29,30?31,32
Note 2 24,25?27,28

Sample description:

Compound Type Concentration
3-[(2-Hydroxyethyl)thio]-6,6-dimethyl-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carbonitrile Solute 75uM
DSS Reference 15uM
bis-Tris-d19 Buffer 11mM
NaCl . 150mM
NaN3 . 0.04%.
Na Formate . 200uM
Show/Hide Spin System Matrix

Spin System Matrix

19 20 21 22 23 24 25 26 27 28 29 30 31 32
19 1.043 -14.0 -14.0 0 0 0 0 0 0 0 0 0 0 0
20 0 1.043 -14.0 0 0 0 0 0 0 0 0 0 0 0
21 0 0 1.043 0 0 0 0 0 0 0 0 0 0 0
22 0 0 0 1.043 -14.0 -14.0 0 0 0 0 0 0 0 0
23 0 0 0 0 1.043 -14.0 0 0 0 0 0 0 0 0
24 0 0 0 0 0 1.043 0 0 0 0 0 0 0 0
25 0 0 0 0 0 0 3.966 -14.0 6.199 6.199 0 0 0 0
26 0 0 0 0 0 0 0 3.966 6.199 6.199 0 0 0 0
27 0 0 0 0 0 0 0 0 3.37 -14.0 0 0 0 0
28 0 0 0 0 0 0 0 0 0 3.37 0 0 0 0
29 0 0 0 0 0 0 0 0 0 0 2.887 -14.0 0 0
30 0 0 0 0 0 0 0 0 0 0 0 2.887 0 0
31 0 0 0 0 0 0 0 0 0 0 0 0 2.507 -14.0
32 0 0 0 0 0 0 0 0 0 0 0 0 0 2.507

Spectra

Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale

Help

To zoom into a region, draw a box around it.
Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM Amplitude Peak Type
1.0 standard
0.332464 standard
0.33249 standard
0.0863229 standard
0.170137 standard
0.0891768 standard
0.0891728 standard
0.170133 standard
0.0863189 standard
1.0 standard
0.3339 standard
0.334868 standard
0.0366861 standard
0.0416943 standard
0.122257 standard
0.113001 standard
0.112571 standard
0.121301 standard
0.0395712 standard
0.0339821 standard
1.0 standard
0.333236 standard
0.33355 standard
0.0502093 standard
0.132755 standard
0.104041 standard
0.103793 standard
0.132329 standard
0.0494791 standard
1.0 standard
0.332985 standard
0.332946 standard
0.0592402 standard
0.144567 standard
0.100857 standard
0.100699 standard
0.144328 standard
0.0588803 standard
1.0 standard
0.332654 standard
0.332682 standard
0.0626191 standard
0.148993 standard
0.100017 standard
0.099887 standard
0.148804 standard
0.062348 standard
1.0 standard
0.332437 standard
0.332571 standard
0.0653764 standard
0.152595 standard
0.099365 standard
0.0992562 standard
0.152443 standard
0.0651654 standard
1.0 standard
0.332428 standard
0.332406 standard
0.0777603 standard
0.165728 standard
0.0947145 standard
0.0946892 standard
0.165893 standard
0.0777093 standard
1.0 standard
0.332318 standard
0.332353 standard
0.0813683 standard
0.168363 standard
0.0929436 standard
0.0929286 standard
0.168347 standard
0.0813496 standard
1.0 standard
0.332131 standard
0.332319 standard
0.0833108 standard
0.169487 standard
0.0918458 standard
0.0918368 standard
0.169477 standard
0.0833008 standard
1.0 standard
0.332443 standard
0.332425 standard
0.0841952 standard
0.169695 standard
0.0910313 standard
0.0910421 standard
0.169919 standard
0.0841723 standard
1.0 standard
0.332083 standard
0.331884 standard
0.086272 standard
0.170037 standard
0.0891247 standard
0.0891207 standard
0.170033 standard
0.0862679 standard
1.0 standard
0.332545 standard
0.332328 standard
0.0863808 standard
0.170506 standard
0.0891719 standard
0.0891689 standard
0.170503 standard
0.0863778 standard
1.0 standard
0.332132 standard
0.332191 standard
0.0876442 standard
0.170162 standard
0.0880345 standard
0.0880356 standard
0.170184 standard
0.0880364 standard
1.0 standard
0.332102 standard
0.331909 standard
0.087854 standard
0.170365 standard
0.087854 standard
0.0878521 standard
0.170363 standard
0.087852 standard
1.0 standard
0.33207 standard
0.332037 standard
0.0878633 standard
0.170314 standard
0.0879711 standard
0.08797 standard
0.170312 standard
0.0878621 standard
1.0 standard
0.332465 standard
0.332429 standard
0.0877988 standard
0.170307 standard
0.0877989 standard
0.0878016 standard
0.170336 standard
0.0880522 standard
1.0 standard
0.33219 standard
0.3323 standard
0.0881271 standard
0.169982 standard
0.0881261 standard
0.087851 standard
0.169983 standard
0.0879834 standard
1.0 standard
0.332318 standard
0.332116 standard
0.0875561 standard
0.170636 standard
0.0879972 standard
0.0880022 standard
0.170677 standard
0.0880022 standard
View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks