4-(Dimethylamino)-3,5-difluorobenzamide
Simulation outputs:
![]() |
Parameter | Value | |||||
Field strength | 600.01(MHz) | ||||||
RMSD of the fit | 0.03849 | ||||||
Temperature | 298 K | ||||||
pH | 7.4 | ||||||
InChI | InChI=1S/C9H10F2N2O/c1-13(2)8-6(10)3-5(9(12)14)4-7(8)11/h3-4H,1-2H3,(H2,12,14) | ||||||
Note 1 | peak from 21,22 has extra ampitude at base | ||||||
Additional coupling constants |
|
Sample description:
Compound | Type | Concentration |
---|---|---|
4-(Dimethylamino)-3,5-difluorobenzamide | Solute | 75uM |
DSS | Reference | 15uM |
bis-Tris-d19 | Buffer | 11mM |
NaCl | . | 150mM |
NaN3 | . | 0.04%. |
Na Formate | . | 200uM |
Spin System Matrix
15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | |
---|---|---|---|---|---|---|---|---|
15 | 2.864 | -14.0 | -14.0 | 0 | 0 | 0 | 0 | 0 |
16 | 0 | 2.864 | -14.0 | 0 | 0 | 0 | 0 | 0 |
17 | 0 | 0 | 2.864 | 0 | 0 | 0 | 0 | 0 |
18 | 0 | 0 | 0 | 2.864 | -14.0 | -14.0 | 0 | 0 |
19 | 0 | 0 | 0 | 0 | 2.864 | -14.0 | 0 | 0 |
20 | 0 | 0 | 0 | 0 | 0 | 2.864 | 0 | 0 |
21 | 0 | 0 | 0 | 0 | 0 | 0 | 7.426 | 1.5 |
22 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 7.426 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.8638 | 1.0 | standard |
7.41751 | 0.224462 | standard |
7.43365 | 0.224462 | standard |
2.8638 | 1.0 | standard |
7.30454 | 0.224357 | standard |
7.54662 | 0.224354 | standard |
2.8638 | 1.0 | standard |
7.34489 | 0.224359 | standard |
7.50627 | 0.224359 | standard |
2.8638 | 1.0 | standard |
7.36506 | 0.224395 | standard |
7.4861 | 0.224394 | standard |
2.8638 | 1.0 | standard |
7.37178 | 0.224425 | standard |
7.47937 | 0.224424 | standard |
2.8638 | 1.0 | standard |
7.37716 | 0.22455 | standard |
7.47399 | 0.22455 | standard |
2.8638 | 1.0 | standard |
7.40137 | 0.224588 | standard |
7.44978 | 0.224588 | standard |
2.8638 | 1.0 | standard |
7.40944 | 0.224617 | standard |
7.44172 | 0.224617 | standard |
2.8638 | 1.0 | standard |
7.41347 | 0.224434 | standard |
7.43768 | 0.224434 | standard |
2.8638 | 1.0 | standard |
7.41589 | 0.224411 | standard |
7.43526 | 0.224411 | standard |
2.8638 | 1.0 | standard |
7.41751 | 0.224442 | standard |
7.43365 | 0.224442 | standard |
2.8638 | 1.0 | standard |
7.41866 | 0.224537 | standard |
7.43249 | 0.224537 | standard |
2.8638 | 1.0 | standard |
7.41912 | 0.2244 | standard |
7.43203 | 0.2244 | standard |
2.8638 | 1.0 | standard |
7.41953 | 0.224772 | standard |
7.43163 | 0.224772 | standard |
2.8638 | 1.0 | standard |
7.4202 | 0.224456 | standard |
7.43096 | 0.224456 | standard |
2.8638 | 1.0 | standard |
7.42048 | 0.224666 | standard |
7.43067 | 0.224666 | standard |
2.8638 | 1.0 | standard |
7.42074 | 0.224432 | standard |
7.43042 | 0.224432 | standard |
2.8638 | 1.0 | standard |
7.42185 | 0.224505 | standard |
7.4293 | 0.224505 | standard |