3-Hydroxy-2-methyl-4H-pyran-4-one
Simulation outputs:
                 
             | 
            Parameter | Value | 
| Field strength | 600.01(MHz) | |
| RMSD of the fit | 0.01999 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C6H6O3/c1-4-6(8)5(7)2-3-9-4/h2-3,8H,1H3 | |
| Note 1 | 13?14 | 
Sample description:
| Compound | Type | Concentration | 
|---|---|---|
| 3-Hydroxy-2-methyl-4H-pyran-4-one | Solute | 75uM | 
| DSS | Reference | 15uM | 
| bis-Tris-d19 | Buffer | 11mM | 
| NaCl | . | 150mM | 
| NaN3 | . | 0.04%. | 
| Na Formate | . | 200uM | 
Spin System Matrix
| 10 | 11 | 12 | 13 | 14 | |
|---|---|---|---|---|---|
| 10 | 2.379 | -14.0 | -14.0 | 0 | 0 | 
| 11 | 0 | 2.379 | -14.0 | 0 | 0 | 
| 12 | 0 | 0 | 2.379 | 0 | 0 | 
| 13 | 0 | 0 | 0 | 6.505 | 5.764 | 
| 14 | 0 | 0 | 0 | 0 | 7.996 | 
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type | 
|---|---|---|
| 2.37937 | 1.0 | standard | 
| 6.49988 | 0.171508 | standard | 
| 6.50948 | 0.17138 | standard | 
| 7.99095 | 0.171516 | standard | 
| 8.00055 | 0.171365 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.4294 | 0.156051 | standard | 
| 6.57317 | 0.18561 | standard | 
| 7.92727 | 0.187168 | standard | 
| 8.07113 | 0.155914 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.45523 | 0.16112 | standard | 
| 6.55118 | 0.180655 | standard | 
| 7.94935 | 0.180564 | standard | 
| 8.0452 | 0.161126 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.4679 | 0.164392 | standard | 
| 6.53978 | 0.178709 | standard | 
| 7.96064 | 0.178709 | standard | 
| 8.03253 | 0.164387 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.47206 | 0.165174 | standard | 
| 6.53602 | 0.177907 | standard | 
| 7.96441 | 0.177904 | standard | 
| 8.02837 | 0.165172 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.47542 | 0.165632 | standard | 
| 6.53295 | 0.177272 | standard | 
| 7.96748 | 0.177254 | standard | 
| 8.02511 | 0.165615 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.49018 | 0.17156 | standard | 
| 6.51899 | 0.171531 | standard | 
| 7.98144 | 0.171529 | standard | 
| 8.01026 | 0.171572 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.49503 | 0.171482 | standard | 
| 6.51424 | 0.169964 | standard | 
| 7.98619 | 0.171449 | standard | 
| 8.0054 | 0.170455 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.4975 | 0.171281 | standard | 
| 6.51186 | 0.171431 | standard | 
| 7.98857 | 0.171411 | standard | 
| 8.00293 | 0.171295 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.49899 | 0.171268 | standard | 
| 6.51047 | 0.170656 | standard | 
| 7.98996 | 0.1714 | standard | 
| 8.00154 | 0.171419 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.49988 | 0.171526 | standard | 
| 6.50948 | 0.170127 | standard | 
| 7.99095 | 0.171535 | standard | 
| 8.00055 | 0.171603 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.50057 | 0.171443 | standard | 
| 6.50879 | 0.171332 | standard | 
| 7.99164 | 0.171512 | standard | 
| 7.99986 | 0.170971 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.50087 | 0.171475 | standard | 
| 6.50859 | 0.171422 | standard | 
| 7.99194 | 0.171476 | standard | 
| 7.99956 | 0.17123 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.50117 | 0.171541 | standard | 
| 6.5083 | 0.171374 | standard | 
| 7.99214 | 0.170278 | standard | 
| 7.99936 | 0.171206 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.50156 | 0.171625 | standard | 
| 6.5079 | 0.171624 | standard | 
| 7.99253 | 0.171477 | standard | 
| 7.99897 | 0.171475 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.50166 | 0.171559 | standard | 
| 6.5077 | 0.171286 | standard | 
| 7.99273 | 0.171547 | standard | 
| 7.99877 | 0.171297 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.50186 | 0.171505 | standard | 
| 6.5076 | 0.170965 | standard | 
| 7.99283 | 0.171538 | standard | 
| 7.99857 | 0.170844 | standard | 
| 2.37937 | 1.0 | standard | 
| 6.50255 | 0.171688 | standard | 
| 6.50691 | 0.171527 | standard | 
| 7.99352 | 0.171399 | standard | 
| 7.99798 | 0.171444 | standard |