2-(4-Hydroxyphenyl)acetamide
Simulation outputs:
|
Parameter | Value |
| Field strength | 600.01(MHz) | |
| RMSD of the fit | 0.01343 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C8H9NO2/c9-8(11)5-6-1-3-7(10)4-2-6/h1-4,10H,5H2,(H2,9,11) | |
| Note 1 | 12,13?14,15 |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| 2-(4-Hydroxyphenyl)acetamide | Solute | 75uM |
| DSS | Reference | 15uM |
| bis-Tris-d19 | Buffer | 11mM |
| NaCl | . | 150mM |
| NaN3 | . | 0.04%. |
| Na Formate | . | 200uM |
Spin System Matrix
| 12 | 13 | 14 | 15 | 16 | 17 | |
|---|---|---|---|---|---|---|
| 12 | 6.883 | 1.5 | 8.16 | 0 | 0 | 0 |
| 13 | 0 | 6.883 | 0 | 8.16 | 0 | 0 |
| 14 | 0 | 0 | 7.202 | 1.5 | 0 | 0 |
| 15 | 0 | 0 | 0 | 7.202 | 0 | 0 |
| 16 | 0 | 0 | 0 | 0 | 3.531 | -14.0 |
| 17 | 0 | 0 | 0 | 0 | 0 | 3.531 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 3.53122 | 1.0 | standard |
| 6.87581 | 0.433259 | standard |
| 6.88917 | 0.468188 | standard |
| 7.19528 | 0.467589 | standard |
| 7.20864 | 0.431214 | standard |
| 3.53122 | 1.0 | standard |
| 6.75103 | 0.227467 | standard |
| 6.95657 | 0.716705 | standard |
| 7.12787 | 0.716697 | standard |
| 7.33338 | 0.227465 | standard |
| 3.53122 | 1.0 | standard |
| 6.80138 | 0.287162 | standard |
| 6.9368 | 0.625325 | standard |
| 7.14765 | 0.625321 | standard |
| 7.28306 | 0.287152 | standard |
| 3.53122 | 1.0 | standard |
| 6.82434 | 0.32321 | standard |
| 6.92539 | 0.580342 | standard |
| 7.15902 | 0.580236 | standard |
| 7.26004 | 0.323075 | standard |
| 3.53122 | 1.0 | standard |
| 6.83162 | 0.336113 | standard |
| 6.9213 | 0.564647 | standard |
| 7.16315 | 0.564644 | standard |
| 7.25283 | 0.336177 | standard |
| 3.53122 | 1.0 | standard |
| 6.83735 | 0.347072 | standard |
| 6.91788 | 0.553961 | standard |
| 7.16653 | 0.553824 | standard |
| 7.2471 | 0.347059 | standard |
| 3.53122 | 1.0 | standard |
| 6.86125 | 0.39683 | standard |
| 6.9014 | 0.502691 | standard |
| 7.18304 | 0.50269 | standard |
| 7.2232 | 0.39683 | standard |
| 3.53122 | 1.0 | standard |
| 6.86869 | 0.414387 | standard |
| 6.89541 | 0.485375 | standard |
| 7.18904 | 0.486496 | standard |
| 7.21576 | 0.414359 | standard |
| 3.53122 | 1.0 | standard |
| 6.87226 | 0.422448 | standard |
| 6.89228 | 0.477432 | standard |
| 7.19216 | 0.477462 | standard |
| 7.21215 | 0.422879 | standard |
| 3.53122 | 1.0 | standard |
| 6.87434 | 0.428284 | standard |
| 6.89043 | 0.472038 | standard |
| 7.19401 | 0.471494 | standard |
| 7.2101 | 0.428276 | standard |
| 3.53122 | 1.0 | standard |
| 6.87581 | 0.43326 | standard |
| 6.88917 | 0.468189 | standard |
| 7.19528 | 0.467591 | standard |
| 7.20864 | 0.431216 | standard |
| 3.53122 | 1.0 | standard |
| 6.87678 | 0.438707 | standard |
| 6.88818 | 0.462475 | standard |
| 7.19615 | 0.460474 | standard |
| 7.20766 | 0.439186 | standard |
| 3.53122 | 1.0 | standard |
| 6.87718 | 0.441558 | standard |
| 6.8879 | 0.459485 | standard |
| 7.19654 | 0.459547 | standard |
| 7.20727 | 0.438956 | standard |
| 3.53122 | 1.0 | standard |
| 6.87746 | 0.439725 | standard |
| 6.8875 | 0.460416 | standard |
| 7.19694 | 0.460605 | standard |
| 7.20688 | 0.44204 | standard |
| 3.53122 | 1.0 | standard |
| 6.87805 | 0.441815 | standard |
| 6.88702 | 0.455734 | standard |
| 7.19742 | 0.455734 | standard |
| 7.2064 | 0.441815 | standard |
| 3.53122 | 1.0 | standard |
| 6.87834 | 0.447879 | standard |
| 6.88672 | 0.452877 | standard |
| 7.19761 | 0.450352 | standard |
| 7.2061 | 0.44765 | standard |
| 3.53122 | 1.0 | standard |
| 6.87854 | 0.449164 | standard |
| 6.88653 | 0.453915 | standard |
| 7.19792 | 0.454003 | standard |
| 7.20591 | 0.445662 | standard |
| 3.53122 | 1.0 | standard |
| 6.87952 | 0.452225 | standard |
| 6.88565 | 0.448146 | standard |
| 7.1988 | 0.452737 | standard |
| 7.20493 | 0.452111 | standard |