Methyl 2-aminothiophene-3-carboxylate
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 600.01(MHz) | |
RMSD of the fit | 0.01383 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C6H7NO2S/c1-9-6(8)4-2-3-10-5(4)7/h2-3H,7H2,1H3 | |
Note 1 | 14?15 |
Sample description:
Compound | Type | Concentration |
---|---|---|
Methyl 2-aminothiophene-3-carboxylate | Solute | 75uM |
DSS | Reference | 15uM |
bis-Tris-d19 | Buffer | 11mM |
NaCl | . | 150mM |
NaN3 | . | 0.04%. |
Na Formate | . | 200uM |
Spin System Matrix
11 | 12 | 13 | 14 | 15 | |
---|---|---|---|---|---|
11 | 3.818 | -14.0 | -14.0 | 0 | 0 |
12 | 0 | 3.818 | -14.0 | 0 | 0 |
13 | 0 | 0 | 3.818 | 0 | 0 |
14 | 0 | 0 | 0 | 6.401 | 6.067 |
15 | 0 | 0 | 0 | 0 | 6.999 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
3.81817 | 1.0 | standard |
6.39573 | 0.171065 | standard |
6.40584 | 0.170925 | standard |
6.99383 | 0.171065 | standard |
7.00393 | 0.170926 | standard |
3.81817 | 1.0 | standard |
6.31576 | 0.131374 | standard |
6.46718 | 0.211727 | standard |
6.93257 | 0.211688 | standard |
7.084 | 0.131557 | standard |
3.81817 | 1.0 | standard |
6.34613 | 0.144093 | standard |
6.44715 | 0.198462 | standard |
6.95261 | 0.19846 | standard |
7.05353 | 0.14413 | standard |
3.81817 | 1.0 | standard |
6.36058 | 0.150794 | standard |
6.43635 | 0.191664 | standard |
6.96341 | 0.191657 | standard |
7.03908 | 0.150807 | standard |
3.81817 | 1.0 | standard |
6.36534 | 0.152977 | standard |
6.43258 | 0.189331 | standard |
6.96708 | 0.189366 | standard |
7.03443 | 0.152999 | standard |
3.81817 | 1.0 | standard |
6.369 | 0.154732 | standard |
6.42961 | 0.186588 | standard |
6.97005 | 0.187542 | standard |
7.03066 | 0.154269 | standard |
3.81817 | 1.0 | standard |
6.38533 | 0.162989 | standard |
6.41564 | 0.179116 | standard |
6.98412 | 0.179273 | standard |
7.01443 | 0.161145 | standard |
3.81817 | 1.0 | standard |
6.39058 | 0.167463 | standard |
6.41079 | 0.174797 | standard |
6.98897 | 0.174705 | standard |
7.00908 | 0.167524 | standard |
3.81817 | 1.0 | standard |
6.39316 | 0.169394 | standard |
6.40831 | 0.172824 | standard |
6.99135 | 0.172824 | standard |
7.0065 | 0.169394 | standard |
3.81817 | 1.0 | standard |
6.39474 | 0.170283 | standard |
6.40683 | 0.171927 | standard |
6.99284 | 0.171855 | standard |
7.00502 | 0.170214 | standard |
3.81817 | 1.0 | standard |
6.39573 | 0.171052 | standard |
6.40584 | 0.170953 | standard |
6.99383 | 0.171064 | standard |
7.00393 | 0.170984 | standard |
3.81817 | 1.0 | standard |
6.39653 | 0.171119 | standard |
6.40514 | 0.17116 | standard |
6.99452 | 0.17106 | standard |
7.00324 | 0.171043 | standard |
3.81817 | 1.0 | standard |
6.39682 | 0.171108 | standard |
6.40484 | 0.170019 | standard |
6.99482 | 0.171003 | standard |
7.00294 | 0.169903 | standard |
3.81817 | 1.0 | standard |
6.39702 | 0.171013 | standard |
6.40465 | 0.170995 | standard |
6.99511 | 0.170639 | standard |
7.00264 | 0.171029 | standard |
3.81817 | 1.0 | standard |
6.39752 | 0.171051 | standard |
6.40425 | 0.170169 | standard |
6.99551 | 0.170616 | standard |
7.00225 | 0.17019 | standard |
3.81817 | 1.0 | standard |
6.39761 | 0.170996 | standard |
6.40405 | 0.170934 | standard |
6.99571 | 0.171127 | standard |
7.00205 | 0.171093 | standard |
3.81817 | 1.0 | standard |
6.39781 | 0.17081 | standard |
6.40385 | 0.170803 | standard |
6.99581 | 0.170998 | standard |
7.00185 | 0.1705 | standard |
3.81817 | 1.0 | standard |
6.39851 | 0.171088 | standard |
6.40316 | 0.171088 | standard |
6.9965 | 0.171048 | standard |
7.00116 | 0.171087 | standard |