2,6-Dichloro-5-fluoro-3-pyridinecarbonitrile
Simulation outputs:
![]() |
Parameter | Value | |||
Field strength | 600.01(MHz) | ||||
RMSD of the fit | 0.02254 | ||||
Temperature | 298 K | ||||
pH | 7.4 | ||||
InChI | InChI=1S/C6HCl2FN2/c7-5-3(2-10)1-4(9)6(8)11-5/h1H | ||||
Note 1 | None | ||||
Additional coupling constants |
|
Sample description:
Compound | Type | Concentration |
---|---|---|
2,6-Dichloro-5-fluoro-3-pyridinecarbonitrile | Solute | 75uM |
DSS | Reference | 15uM |
bis-Tris-d19 | Buffer | 11mM |
NaCl | . | 150mM |
NaN3 | . | 0.04%. |
Na Formate | . | 200uM |
Spin System Matrix
12 | |
---|---|
12 | 8.252 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
8.24557 | 1.00009 | standard |
8.25744 | 1.00009 | standard |
8.16247 | 1.0 | standard |
8.34054 | 1.0 | standard |
8.19215 | 1.00001 | standard |
8.31086 | 1.00001 | standard |
8.20698 | 1.0 | standard |
8.29602 | 1.0 | standard |
8.21193 | 1.0 | standard |
8.29107 | 1.0 | standard |
8.21589 | 1.0 | standard |
8.28712 | 1.0 | standard |
8.23369 | 1.00009 | standard |
8.26931 | 1.00009 | standard |
8.23963 | 1.00009 | standard |
8.26337 | 1.00009 | standard |
8.2426 | 1.00009 | standard |
8.26041 | 1.00009 | standard |
8.24438 | 1.00008 | standard |
8.25862 | 1.00008 | standard |
8.24557 | 1.00008 | standard |
8.25744 | 1.00008 | standard |
8.24641 | 1.0004 | standard |
8.25659 | 1.0004 | standard |
8.24675 | 1.00008 | standard |
8.25625 | 1.00008 | standard |
8.24705 | 1.00008 | standard |
8.25595 | 1.00008 | standard |
8.24754 | 1.00008 | standard |
8.25546 | 1.00008 | standard |
8.24775 | 1.00036 | standard |
8.25525 | 1.00036 | standard |
8.24794 | 1.00008 | standard |
8.25506 | 1.00008 | standard |
8.24876 | 1.00226 | standard |
8.25424 | 1.00226 | standard |