3-Acetyl-2,4-dimethylpyrrole
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 600.01(MHz) | |
RMSD of the fit | 0.02819 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C8H11NO/c1-5-4-9-6(2)8(5)7(3)10/h4,9H,1-3H3 | |
Note 1 | 11,12,13?14,15,16?17,18,19 |
Sample description:
Compound | Type | Concentration |
---|---|---|
3-Acetyl-2,4-dimethylpyrrole | Solute | 75uM |
DSS | Reference | 15uM |
bis-Tris-d19 | Buffer | 11mM |
NaCl | . | 150mM |
NaN3 | . | 0.04%. |
Na Formate | . | 200uM |
Spin System Matrix
11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | |
---|---|---|---|---|---|---|---|---|---|---|
11 | 2.46 | -14.0 | -14.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
12 | 0 | 2.46 | -14.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
13 | 0 | 0 | 2.46 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
14 | 0 | 0 | 0 | 2.456 | -14.0 | -14.0 | 0 | 0 | 0 | 0 |
15 | 0 | 0 | 0 | 0 | 2.456 | -14.0 | 0 | 0 | 0 | 0 |
16 | 0 | 0 | 0 | 0 | 0 | 2.456 | 0 | 0 | 0 | 0 |
17 | 0 | 0 | 0 | 0 | 0 | 0 | 2.218 | -14.0 | -14.0 | 0 |
18 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2.218 | -14.0 | 0 |
19 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2.218 | 0 |
20 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 6.532 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.2179 | 0.844833 | standard |
2.45647 | 1.0002 | standard |
2.45979 | 1.00007 | standard |
6.53191 | 0.281584 | standard |
2.21795 | 0.511375 | standard |
2.45811 | 1.0 | standard |
6.53191 | 0.166911 | standard |
2.21791 | 0.509893 | standard |
2.45813 | 1.0 | standard |
6.53191 | 0.168364 | standard |
2.2179 | 0.512663 | standard |
2.45813 | 1.0 | standard |
6.53191 | 0.169977 | standard |
2.2179 | 0.515015 | standard |
2.45813 | 1.0 | standard |
6.53191 | 0.170802 | standard |
2.2179 | 0.517658 | standard |
2.45813 | 1.0 | standard |
6.53191 | 0.171879 | standard |
2.2179 | 0.564283 | standard |
2.45813 | 1.0 | standard |
6.53191 | 0.187933 | standard |
2.2179 | 0.643858 | standard |
2.45811 | 1.0 | standard |
6.53191 | 0.214383 | standard |
2.2179 | 0.735435 | standard |
2.45689 | 1.00012 | standard |
2.45936 | 1.00011 | standard |
6.53191 | 0.245067 | standard |
2.2179 | 0.799863 | standard |
2.45658 | 0.999786 | standard |
2.45967 | 1.0003 | standard |
6.53191 | 0.266322 | standard |
2.2179 | 0.844539 | standard |
2.45647 | 1.0002 | standard |
2.45979 | 0.999643 | standard |
6.53191 | 0.28163 | standard |
2.2179 | 0.876742 | standard |
2.45641 | 0.999146 | standard |
2.45984 | 1.00028 | standard |
6.53191 | 0.292298 | standard |
2.2179 | 0.890386 | standard |
2.4564 | 1.00085 | standard |
2.45986 | 1.00049 | standard |
6.53191 | 0.296764 | standard |
2.2179 | 0.900679 | standard |
2.45639 | 0.99878 | standard |
2.45987 | 1.00108 | standard |
6.53191 | 0.300147 | standard |
2.2179 | 0.92019 | standard |
2.45637 | 1.00059 | standard |
2.45988 | 1.00053 | standard |
6.53191 | 0.305045 | standard |
2.2179 | 0.925484 | standard |
2.45637 | 0.999237 | standard |
2.45989 | 1.00045 | standard |
6.53191 | 0.308483 | standard |
2.2179 | 0.931436 | standard |
2.45636 | 1.00034 | standard |
2.45989 | 1.00015 | standard |
6.53191 | 0.311473 | standard |
2.2179 | 0.957616 | standard |
2.45635 | 0.999533 | standard |
2.45991 | 1.00008 | standard |
6.53191 | 0.318814 | standard |