Guided Ideographic Spin System Model Optimization

Global links:

GISSMO Home

GISSMO Library

GISSMO Tutorial

GISSMO-GUI

Web Services:

Peak Search

Mixture Simulation

Mol to jpg conversion

Simulation: simulation_1

Gateway cross link

Download simulation data

View entry XML

Download entry NMR-STAR

Download entry NMReDATA

External links:

NMRFAM Servers

pKa (R. Williams)

1H NMR (Hans J. Reich)

N1,N1,N8,N8-tetramethylnaphthalene-1,8-diamine

Simulation outputs:

InChI=1S/C14H18N2/c1-15(2)12-9-5-7-11-8-6-10-13(14(11)12)16(3)4/h5-10H,1-4H3 Parameter Value
Field strength 600.01(MHz)
RMSD of the fit 0.02428
Temperature 298 K
pH 7.4
InChI InChI=1S/C14H18N2/c1-15(2)12-9-5-7-11-8-6-10-13(14(11)12)16(3)4/h5-10H,1-4H3
Note 1 33,34?31,32

Sample description:

Compound Type Concentration
N1,N1,N8,N8-tetramethylnaphthalene-1,8-diamine Solute 75uM
DSS Reference 15uM
bis-Tris-d19 Buffer 11mM
NaCl . 150mM
NaN3 . 0.04%.
Na Formate . 200uM
Show/Hide Spin System Matrix

Spin System Matrix

17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34
17 3.154 -14.0 -14.0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
18 0 3.154 -14.0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
19 0 0 3.154 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
20 0 0 0 3.154 -14.0 -14.0 0 0 0 0 0 0 0 0 0 0 0 0
21 0 0 0 0 3.154 -14.0 0 0 0 0 0 0 0 0 0 0 0 0
22 0 0 0 0 0 3.154 0 0 0 0 0 0 0 0 0 0 0 0
23 0 0 0 0 0 0 3.154 -14.0 -14.0 0 0 0 0 0 0 0 0 0
24 0 0 0 0 0 0 0 3.154 -14.0 0 0 0 0 0 0 0 0 0
25 0 0 0 0 0 0 0 0 3.154 0 0 0 0 0 0 0 0 0
26 0 0 0 0 0 0 0 0 0 3.154 -14.0 -14.0 0 0 0 0 0 0
27 0 0 0 0 0 0 0 0 0 0 3.154 -14.0 0 0 0 0 0 0
28 0 0 0 0 0 0 0 0 0 0 0 3.154 0 0 0 0 0 0
29 0 0 0 0 0 0 0 0 0 0 0 0 7.716 0 8.155 0 8.873 0
30 0 0 0 0 0 0 0 0 0 0 0 0 0 7.716 0 8.155 0 8.873
31 0 0 0 0 0 0 0 0 0 0 0 0 0 0 7.931 1.5 0 0
32 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 7.931 0 0
33 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8.058 0
34 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8.058

Spectra

Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale

Help

To zoom into a region, draw a box around it.
Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM Amplitude Peak Type
1.0 standard
0.032404 standard
0.0638694 standard
0.0395191 standard
0.0748428 standard
0.0658596 standard
0.0879246 standard
0.080823 standard
1.0 standard
0.0103931 standard
0.0304961 standard
0.161884 standard
0.109537 standard
0.0271501 standard
1.0 standard
0.0144651 standard
0.047918 standard
0.0944751 standard
0.112681 standard
0.131864 standard
0.044096 standard
1.0 standard
0.0175411 standard
0.0549241 standard
0.0727326 standard
0.102992 standard
0.113348 standard
0.055725 standard
1.0 standard
0.018769 standard
0.0569645 standard
0.0670682 standard
0.099583 standard
0.055063 standard
0.106963 standard
0.0595941 standard
1.0 standard
0.0199343 standard
0.0583482 standard
0.0631001 standard
0.0966183 standard
0.0523611 standard
0.104712 standard
0.0625221 standard
1.0 standard
0.0265133 standard
0.0630228 standard
0.0483403 standard
0.0830875 standard
0.0581523 standard
0.0948611 standard
0.0738833 standard
1.0 standard
0.0291182 standard
0.063353 standard
0.0435934 standard
0.0790392 standard
0.0620209 standard
0.0916466 standard
0.0774954 standard
1.0 standard
0.0306948 standard
0.0634187 standard
0.0416002 standard
0.0765697 standard
0.0639772 standard
0.0897875 standard
0.0791623 standard
1.0 standard
0.0316073 standard
0.0639041 standard
0.0404545 standard
0.0755088 standard
0.0651061 standard
0.0886634 standard
0.0802052 standard
1.0 standard
0.032405 standard
0.0638664 standard
0.0395211 standard
0.0748438 standard
0.0658596 standard
0.0879246 standard
0.0808227 standard
1.0 standard
0.0327187 standard
0.0634321 standard
0.0387037 standard
0.0735477 standard
0.0667605 standard
0.0870801 standard
0.0816674 standard
1.0 standard
0.0330838 standard
0.0636321 standard
0.0387849 standard
0.0738681 standard
0.0669838 standard
0.0869002 standard
0.0819342 standard
1.0 standard
0.0330923 standard
0.0638079 standard
0.0385238 standard
0.0740766 standard
0.0667085 standard
0.0866123 standard
0.0820842 standard
1.0 standard
0.0333711 standard
0.0640841 standard
0.0379386 standard
0.0726524 standard
0.0669508 standard
0.086161 standard
0.0825032 standard
1.0 standard
0.0343263 standard
0.0632935 standard
0.0375863 standard
0.072809 standard
0.0677816 standard
0.0851242 standard
0.0836702 standard
1.0 standard
0.0344126 standard
0.0628772 standard
0.0372957 standard
0.0714925 standard
0.0680439 standard
0.0849912 standard
0.0837652 standard
1.0 standard
0.0347779 standard
0.0641059 standard
0.0363611 standard
0.07171 standard
0.0694824 standard
0.0847192 standard
0.0841002 standard
View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks View GSD Peaks