2,6-Dichloropyridin-3-amine
Simulation outputs:
|
Parameter | Value |
| Field strength | 600.01(MHz) | |
| RMSD of the fit | 0.01523 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C5H4Cl2N2/c6-4-2-1-3(8)5(7)9-4/h1-2H,8H2 | |
| Note 1 | 10?11 |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| 2,6-Dichloropyridin-3-amine | Solute | 75uM |
| DSS | Reference | 15uM |
| bis-Tris-d19 | Buffer | 11mM |
| NaCl | . | 150mM |
| NaN3 | . | 0.04%. |
| Na Formate | . | 200uM |
Spin System Matrix
| 10 | 11 | |
|---|---|---|
| 10 | 7.254 | 8.608 |
| 11 | 0 | 7.339 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 7.24655 | 0.721133 | standard |
| 7.26093 | 1.0 | standard |
| 7.33274 | 1.0 | standard |
| 7.34712 | 0.721133 | standard |
| 7.0756 | 0.0339301 | standard |
| 7.29683 | 1.0 | standard |
| 7.51817 | 0.0339301 | standard |
| 7.14228 | 0.0717381 | standard |
| 7.28911 | 1.0 | standard |
| 7.30466 | 1.0 | standard |
| 7.45139 | 0.0717601 | standard |
| 7.17468 | 0.123199 | standard |
| 7.28278 | 1.00001 | standard |
| 7.31089 | 1.00001 | standard |
| 7.41899 | 0.123199 | standard |
| 7.18522 | 0.149385 | standard |
| 7.28104 | 1.0 | standard |
| 7.31263 | 1.0 | standard |
| 7.40845 | 0.149385 | standard |
| 7.19341 | 0.175171 | standard |
| 7.27958 | 1.0 | standard |
| 7.31409 | 1.0 | standard |
| 7.40026 | 0.175171 | standard |
| 7.22772 | 0.388441 | standard |
| 7.27075 | 1.0 | standard |
| 7.32292 | 1.0 | standard |
| 7.36594 | 0.388441 | standard |
| 7.23763 | 0.525043 | standard |
| 7.26628 | 1.0 | standard |
| 7.32738 | 1.0 | standard |
| 7.35604 | 0.525043 | standard |
| 7.24219 | 0.614283 | standard |
| 7.2637 | 1.0 | standard |
| 7.32996 | 1.0 | standard |
| 7.35148 | 0.614283 | standard |
| 7.24486 | 0.676156 | standard |
| 7.26202 | 1.0 | standard |
| 7.33165 | 1.0 | standard |
| 7.3488 | 0.676156 | standard |
| 7.24655 | 0.721129 | standard |
| 7.26093 | 1.0 | standard |
| 7.33274 | 1.0 | standard |
| 7.34712 | 0.721129 | standard |
| 7.24774 | 0.755349 | standard |
| 7.26003 | 1.0 | standard |
| 7.33363 | 1.0 | standard |
| 7.34593 | 0.755349 | standard |
| 7.24823 | 0.769583 | standard |
| 7.25964 | 1.0 | standard |
| 7.33403 | 1.0 | standard |
| 7.34543 | 0.769583 | standard |
| 7.24863 | 0.782189 | standard |
| 7.25934 | 1.0 | standard |
| 7.33433 | 1.0 | standard |
| 7.34504 | 0.782189 | standard |
| 7.24923 | 0.80363 | standard |
| 7.25884 | 1.0 | standard |
| 7.33482 | 1.0 | standard |
| 7.34444 | 0.80363 | standard |
| 7.24952 | 0.812881 | standard |
| 7.25865 | 1.0 | standard |
| 7.33502 | 1.0 | standard |
| 7.34414 | 0.812881 | standard |
| 7.24982 | 0.821352 | standard |
| 7.25845 | 1.0 | standard |
| 7.33522 | 1.0 | standard |
| 7.34385 | 0.821352 | standard |
| 7.25091 | 0.859513 | standard |
| 7.25746 | 1.0 | standard |
| 7.33621 | 1.0 | standard |
| 7.34276 | 0.859513 | standard |