2-(4-Methoxyphenoxy)ethanethioamide
Simulation outputs:
|
Parameter | Value |
| Field strength | 600.01(MHz) | |
| RMSD of the fit | 0.14741 | |
| Temperature | 298 K | |
| pH | 7.4 | |
| InChI | InChI=1S/C9H11NO2S/c1-11-7-2-4-8(5-3-7)12-6-9(10)13/h2-5H,6H2,1H3,(H2,10,13) | |
| Note 1 | 21,22 missing (saturated?) |
Sample description:
| Compound | Type | Concentration |
|---|---|---|
| 2-(4-Methoxyphenoxy)ethanethioamide | Solute | 75uM |
| DSS | Reference | 15uM |
| bis-Tris-d19 | Buffer | 11mM |
| NaCl | . | 150mM |
| NaN3 | . | 0.04%. |
| Na Formate | . | 200uM |
Spin System Matrix
| 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | |
|---|---|---|---|---|---|---|---|---|---|
| 14 | 3.801 | -14.0 | -14.0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 15 | 0 | 3.801 | -14.0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 16 | 0 | 0 | 3.801 | 0 | 0 | 0 | 0 | 0 | 0 |
| 17 | 0 | 0 | 0 | 6.985 | 1.5 | 7.0 | 0.5 | 0 | 0 |
| 18 | 0 | 0 | 0 | 0 | 6.985 | 0.5 | 7.0 | 0 | 0 |
| 19 | 0 | 0 | 0 | 0 | 0 | 6.985 | 1.5 | 0 | 0 |
| 20 | 0 | 0 | 0 | 0 | 0 | 0 | 6.985 | 0 | 0 |
| 21 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4.945 | 14.21 |
| 22 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4.955 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
| PPM | Amplitude | Peak Type |
|---|---|---|
| 3.80081 | 0.750013 | standard |
| 4.92511 | 0.0126821 | standard |
| 4.94928 | 0.338125 | standard |
| 4.9505 | 0.338154 | standard |
| 4.97466 | 0.0126341 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.750387 | standard |
| 4.94989 | 0.500329 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.750185 | standard |
| 4.94989 | 0.499857 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.750104 | standard |
| 4.94984 | 0.499583 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.750232 | standard |
| 4.94989 | 0.499314 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.749851 | standard |
| 4.94989 | 0.499036 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.749952 | standard |
| 4.94989 | 0.494214 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.750039 | standard |
| 4.94989 | 0.478798 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.75019 | standard |
| 4.94989 | 0.444938 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.749785 | standard |
| 4.92057 | 0.00916564 | standard |
| 4.94984 | 0.396486 | standard |
| 4.9792 | 0.00927131 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.749999 | standard |
| 4.92511 | 0.012815 | standard |
| 4.94928 | 0.338117 | standard |
| 4.9505 | 0.338082 | standard |
| 4.97466 | 0.012818 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.749984 | standard |
| 4.92828 | 0.0159634 | standard |
| 4.94877 | 0.294166 | standard |
| 4.95101 | 0.294147 | standard |
| 4.9714 | 0.0159714 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.750044 | standard |
| 4.92956 | 0.0176512 | standard |
| 4.94861 | 0.279755 | standard |
| 4.95117 | 0.279755 | standard |
| 4.97021 | 0.0176642 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.750037 | standard |
| 4.93065 | 0.019317 | standard |
| 4.94848 | 0.270524 | standard |
| 4.9512 | 0.270561 | standard |
| 4.96902 | 0.019282 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.749963 | standard |
| 4.93254 | 0.0227808 | standard |
| 4.94834 | 0.254546 | standard |
| 4.95143 | 0.254546 | standard |
| 4.96724 | 0.0227808 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.750045 | standard |
| 4.93323 | 0.0244347 | standard |
| 4.94823 | 0.247811 | standard |
| 4.95155 | 0.247868 | standard |
| 4.96644 | 0.0245477 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.749801 | standard |
| 4.93392 | 0.0260886 | standard |
| 4.94812 | 0.243107 | standard |
| 4.95155 | 0.243106 | standard |
| 4.96585 | 0.0261716 | standard |
| 6.98459 | 1.0 | standard |
| 3.80081 | 0.749984 | standard |
| 4.9368 | 0.0364833 | standard |
| 4.94781 | 0.222501 | standard |
| 4.95196 | 0.222503 | standard |
| 4.96288 | 0.0365093 | standard |
| 6.98459 | 1.0 | standard |