5-Methyl-3-isoxazolecarbonitrile
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 600.01(MHz) | |
RMSD of the fit | 0.03880 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C5H4N2O/c1-4-2-5(3-6)7-8-4/h2H,1H3 | |
Note 1 | garbage in aliphatic region |
Sample description:
Compound | Type | Concentration |
---|---|---|
5-Methyl-3-isoxazolecarbonitrile | Solute | 75uM |
DSS | Reference | 15uM |
bis-Tris-d19 | Buffer | 11mM |
NaCl | . | 150mM |
NaN3 | . | 0.04%. |
Na Formate | . | 200uM |
Spin System Matrix
9 | 10 | 11 | 12 | |
---|---|---|---|---|
9 | 2.522 | -14.0 | -14.0 | 0 |
10 | 0 | 2.522 | -14.0 | 0 |
11 | 0 | 0 | 2.522 | 0 |
12 | 0 | 0 | 0 | 6.648 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.5218 | 1.0 | standard |
6.64756 | 0.333333 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333325 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.331555 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333332 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333248 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.331855 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333333 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333758 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333333 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333333 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333889 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333281 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333536 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333333 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.332655 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333325 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.332305 | standard |
2.5218 | 1.0 | standard |
6.64756 | 0.333333 | standard |