Methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
Simulation outputs:
![]() |
Parameter | Value |
Field strength | 600.01(MHz) | |
RMSD of the fit | 0.01670 | |
Temperature | 298 K | |
pH | 7.4 | |
InChI | InChI=1S/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 | |
Note 1 | 12,13,14?15,16,17 |
Sample description:
Compound | Type | Concentration |
---|---|---|
Methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate | Solute | 75uM |
DSS | Reference | 15uM |
bis-Tris-d19 | Buffer | 11mM |
NaCl | . | 150mM |
NaN3 | . | 0.04%. |
Na Formate | . | 200uM |
Spin System Matrix
12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | |
---|---|---|---|---|---|---|---|---|---|---|
12 | 2.156 | -14.0 | -14.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
13 | 0 | 2.156 | -14.0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
14 | 0 | 0 | 2.156 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
15 | 0 | 0 | 0 | 2.408 | -14.0 | -14.0 | 0 | 0 | 0 | 0 |
16 | 0 | 0 | 0 | 0 | 2.408 | -14.0 | 0 | 0 | 0 | 0 |
17 | 0 | 0 | 0 | 0 | 0 | 2.408 | 0 | 0 | 0 | 0 |
18 | 0 | 0 | 0 | 0 | 0 | 0 | 3.78 | -14.0 | -14.0 | 0 |
19 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.78 | -14.0 | 0 |
20 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 3.78 | 0 |
21 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 6.169 |
Spectra
Select field strength to view simulated spectra and peak lists (standard and GSD): Autoscale
Help
To zoom into a region, draw a box around it.Hover over the x/y-axis and use mouse-wheel to zoom in/out.
Hover over the x/y-axis hold down left-button to move around the spectra.
(De)activate a spectrum by clicking on its legend.
PPM | Amplitude | Peak Type |
---|---|---|
2.1561 | 1.0 | standard |
2.40764 | 0.99887 | standard |
3.77998 | 0.999716 | standard |
6.16918 | 0.328922 | standard |
2.15613 | 1.0 | standard |
2.40762 | 0.999922 | standard |
3.77998 | 0.990397 | standard |
6.16918 | 0.325089 | standard |
2.15611 | 1.0 | standard |
2.40764 | 0.999067 | standard |
3.77998 | 0.995729 | standard |
6.16918 | 0.326564 | standard |
2.15611 | 1.0 | standard |
2.40764 | 0.999832 | standard |
3.77998 | 0.997252 | standard |
6.16918 | 0.327943 | standard |
2.15611 | 1.0 | standard |
2.40764 | 0.999003 | standard |
3.77998 | 0.997837 | standard |
6.16918 | 0.328166 | standard |
2.15611 | 1.0 | standard |
2.40764 | 0.9992 | standard |
3.77998 | 0.997858 | standard |
6.16918 | 0.328051 | standard |
2.1561 | 1.0 | standard |
2.40764 | 0.999553 | standard |
3.77998 | 0.998756 | standard |
6.16918 | 0.328589 | standard |
2.1561 | 1.0 | standard |
2.40764 | 0.999723 | standard |
3.77998 | 0.999152 | standard |
6.16918 | 0.328443 | standard |
2.1561 | 1.0 | standard |
2.40764 | 0.999463 | standard |
3.77998 | 0.998455 | standard |
6.16918 | 0.328301 | standard |
2.1561 | 0.999909 | standard |
2.40764 | 1.0 | standard |
3.77998 | 0.999608 | standard |
6.16918 | 0.328349 | standard |
2.1561 | 1.0 | standard |
2.40764 | 0.999753 | standard |
3.77998 | 0.99874 | standard |
6.16918 | 0.328478 | standard |
2.1561 | 1.0 | standard |
2.40764 | 0.99925 | standard |
3.77998 | 0.9997 | standard |
6.16918 | 0.328381 | standard |
2.1561 | 1.0 | standard |
2.40764 | 0.999931 | standard |
3.77998 | 0.99981 | standard |
6.16918 | 0.328741 | standard |
2.1561 | 0.999316 | standard |
2.40764 | 0.999444 | standard |
3.77998 | 1.0 | standard |
6.16918 | 0.328311 | standard |
2.1561 | 1.0 | standard |
2.40764 | 0.999144 | standard |
3.77998 | 0.999875 | standard |
6.16918 | 0.328033 | standard |
2.1561 | 1.0 | standard |
2.40764 | 0.999909 | standard |
3.77998 | 0.99999 | standard |
6.16918 | 0.328968 | standard |
2.1561 | 0.99994 | standard |
2.40764 | 0.999477 | standard |
3.77998 | 1.0 | standard |
6.16918 | 0.328148 | standard |
2.1561 | 0.999393 | standard |
2.40764 | 1.0 | standard |
3.77998 | 0.999926 | standard |
6.16918 | 0.32914 | standard |